Find this useful? Enter your email to receive occasional updates for securing PHP code.

Signing you up...

Thank you for signing up!

PHP Decode

include $GLOBALS['OOO0000O0']('Li4vY29yZS5waHA='); $GLOBALS[$GLOBALS['OOO0000O0']('SUlJ..

Decoded Output download

<?   
include $GLOBALS['OOO0000O0']('Li4vY29yZS5waHA='); 
$GLOBALS[$GLOBALS['OOO0000O0']('SUlJSUlJSUlJMWxs')]($GLOBALS['OOO0000O0']('Q29udGVudC1UeXBlOiBhcHBsaWNhdGlvbi9qc29u')); 
$post_id = $_REQUEST[$GLOBALS['OOO0000O0']('cG9zdF9pZA==')]; 
$token = $GLOBALS[$GLOBALS['OOO0000O0']('SUlJSUlJSUlsMTFJ')]($GLOBALS['OOO0000O0']('fA=='),$_REQUEST[$GLOBALS['OOO0000O0']('dG9rZW4=')]); 
$user_id = $GLOBALS[$GLOBALS['OOO0000O0']('SUlJSUlJSUlJbDFs')]($token[0]); 
$token = $GLOBALS[$GLOBALS['OOO0000O0']('SUlJSUlJSUlJbDFs')]($token[1]); 
$type = $_REQUEST[$GLOBALS['OOO0000O0']('dHlwZQ==')]; 
$link = $_REQUEST[$GLOBALS['OOO0000O0']('bGluaw==')]; 
$message = $_REQUEST[$GLOBALS['OOO0000O0']('bWVzc2FnZQ==')]; 
$reaction = $_REQUEST[$GLOBALS['OOO0000O0']('cmVhY3Rpb24=')]; 
$reaction = $reaction[$GLOBALS[$GLOBALS['OOO0000O0']('SUlJSUlJSUlsSUlJ')]($reaction)]; 
$message = $message[$GLOBALS[$GLOBALS['OOO0000O0']('SUlJSUlJSUlsSUlJ')]($message)]; 
$message = $GLOBALS[$GLOBALS['OOO0000O0']('SUlJSUlJSUlsbElJ')]($message); 
if (!$post_id ||!$token ||!$user_id) { 
echo json_encode([ 
$GLOBALS['OOO0000O0']('c3VjY2Vzcw==') =>false, 
$GLOBALS['OOO0000O0']('bXNn') =>$GLOBALS['OOO0000O0']('UG9zdCBJRCByZXF1aXJlZC4=') 
],JSON_PRETTY_PRINT); 
exit; 
} 
function IIIIIIII1IIl($reaction) 
{ 
$IIIIIIII1II1 = $GLOBALS['OOO0000O0']('MTYzNTg1NTQ4NjY2Njk5OQ=='); 
if ($reaction == $GLOBALS['OOO0000O0']('TE9WRQ==')) : 
$IIIIIIII1II1 = $GLOBALS['OOO0000O0']('MTY3ODUyNDkzMjQzNDEwMg=='); 
elseif ($reaction == $GLOBALS['OOO0000O0']('Q0FSRQ==')) : 
$IIIIIIII1II1 = $GLOBALS['OOO0000O0']('MTY3ODUyNDkzMjQzNDEwMg=='); 
elseif ($reaction == $GLOBALS['OOO0000O0']('SEFIQQ==')) : 
$IIIIIIII1II1 = $GLOBALS['OOO0000O0']('MTE1OTQwNjU4NzY0OTYz'); 
elseif ($reaction == $GLOBALS['OOO0000O0']('V09X')) : 
$IIIIIIII1II1 = $GLOBALS['OOO0000O0']('NDc4NTQ3MzE1NjUwMTQ0'); 
elseif ($reaction == $GLOBALS['OOO0000O0']('U0FE')) : 
$IIIIIIII1II1 = $GLOBALS['OOO0000O0']('OTA4NTYzNDU5MjM2NDY2'); 
elseif ($reaction == $GLOBALS['OOO0000O0']('QU5HUlk=')) : 
$IIIIIIII1II1 = $GLOBALS['OOO0000O0']('NDQ0ODEzMzQyMzkyMTM3'); 
endif; 
return $IIIIIIII1II1; 
} 
$post_id = $GLOBALS[$GLOBALS['OOO0000O0']('SUlJSUlJSUkxSWxJ')]($GLOBALS['OOO0000O0']('ZmVlZGJhY2s6') .$post_id); 
if ($type == 1) { 
$IIIIIIII1II1 = IIIIIIII1IIl($reaction); 
$IIIIIIIIIIll = $GLOBALS['OOO0000O0']('aHR0cHM6Ly9ncmFwaC5mYWNlYm9vay5jb20vZ3JhcGhxbD9kb2NfaWQ9NTcwMzQxODIwOTY4MDEyNiZ2YXJpYWJsZXM9eyJpbnB1dCI6eyJhdHRyaWJ1dGlvbl9pZF92MiI6IkNvbWV0U2luZ2xlUG9zdFJvb3QucmVhY3QsY29tZXQucG9zdC5zaW5nbGUsdmlhX2NvbGRfc3RhcnQsMTY4MDMxODQ0OTc5Nyw3ODMwNTgsLCIsImZlZWRiYWNrX2lkIjoi') .$post_id .$GLOBALS['OOO0000O0']('IiwiZmVlZGJhY2tfcmVhY3Rpb25faWQiOiI=') .$IIIIIIII1II1 .$GLOBALS['OOO0000O0']('IiwiZmVlZGJhY2tfc291cmNlIjoiT0JKRUNUIiwiaXNfdHJhY2tpbmdfZW5jcnlwdGVkIjpmYWxzZSwiYWN0b3JfaWQiOiI=') .$user_id .$GLOBALS['OOO0000O0']('IiwiY2xpZW50X211dGF0aW9uX2lkIjoiMiJ9LCJ1c2VEZWZhdWx0QWN0b3IiOmZhbHNlLCJzY2FsZSI6MS41fSZhY2Nlc3NfdG9rZW49') .$token .$GLOBALS['OOO0000O0']('Jm1ldGhvZD1wb3N0'); 
$IIIIIIIII11I  = json_decode(IIIIIIIII1I1($IIIIIIIIIIll),true); 
if (!isset($IIIIIIIII11I[$GLOBALS['OOO0000O0']('ZXJyb3Jz')]) &&!isset($IIIIIIIII11I[$GLOBALS['OOO0000O0']('ZXJyb3I=')])) { 
echo json_encode([ 
$GLOBALS['OOO0000O0']('c3VjY2Vzcw==') =>true, 
],JSON_PRETTY_PRINT); 
exit; 
}else { 
$msg = ($IIIIIIIII11I[$GLOBALS['OOO0000O0']('ZXJyb3Jz')][0][$GLOBALS['OOO0000O0']('bWVzc2FnZQ==')] .$GLOBALS['OOO0000O0']('LQ==') .$IIIIIIIII11I[$GLOBALS['OOO0000O0']('ZXJyb3Jz')][0][$GLOBALS['OOO0000O0']('c3VtbWFyeQ==')]) ??($IIIIIIIII11I[$GLOBALS['OOO0000O0']('ZXJyb3I=')][$GLOBALS['OOO0000O0']('bWVzc2FnZQ==')] .$GLOBALS['OOO0000O0']('LQ==') .$IIIIIIIII11I[$GLOBALS['OOO0000O0']('ZXJyb3I=')][$GLOBALS['OOO0000O0']('c3VtbWFyeQ==')]); 
echo json_encode([ 
$GLOBALS['OOO0000O0']('c3VjY2Vzcw==') =>false, 
$GLOBALS['OOO0000O0']('bXNn') =>$msg 
],JSON_PRETTY_PRINT); 
exit; 
} 
}else if ($type == 2) { 
$IIIIIIIIIIll = $GLOBALS['OOO0000O0']('aHR0cHM6Ly9ncmFwaC5mYWNlYm9vay5jb20vdjEwLjAvZ3JhcGhxbD9kb2NfaWQ9ODk1NTI4MTM2MTIxMDYwNCZ2YXJpYWJsZXM9eyJkaXNwbGF5Q29tbWVudHNGZWVkYmFja0NvbnRleHQiOm51bGwsImRpc3BsYXlDb21tZW50c0NvbnRleHRFbmFibGVDb21tZW50IjpudWxsLCJkaXNwbGF5Q29tbWVudHNDb250ZXh0SXNBZFByZXZpZXciOm51bGwsImRpc3BsYXlDb21tZW50c0NvbnRleHRJc0FnZ3JlZ2F0ZWRTaGFyZSI6bnVsbCwiZGlzcGxheUNvbW1lbnRzQ29udGV4dElzU3RvcnlTZXQiOm51bGwsImZlZWRMb2NhdGlvbiI6IkNPTUVUX01FRElBX1ZJRVdFUiIsImZlZWRiYWNrU291cmNlIjo2NSwiZm9jdXNDb21tZW50SUQiOm51bGwsImdyb3VwSUQiOm51bGwsImluY2x1ZGVOZXN0ZWRDb21tZW50cyI6ZmFsc2UsImlucHV0Ijp7ImF0dGFjaG1lbnRzIjpudWxsLCJmZWVkYmFja19pZCI6Ig==') .$post_id .$GLOBALS['OOO0000O0']('IiwiZm9ybWF0dGluZ19zdHlsZSI6bnVsbCwibWVzc2FnZSI6eyJyYW5nZXMiOltdLCJ0ZXh0Ijoi') .$message .$GLOBALS['OOO0000O0']('In0sImF0dHJpYnV0aW9uX2lkX3YyIjoiQ29tZXRQaG90b1Jvb3QucmVhY3QsY29tZXQubWVkaWF2aWV3ZXIucGhvdG8sdmlhX2NvbGRfc3RhcnQsMTY4MDMzNTU2MzQ0MywyNTAzMTYsLCIsImlzX3RyYWNraW5nX2VuY3J5cHRlZCI6ZmFsc2UsImZlZWRiYWNrX3NvdXJjZSI6Ik1FRElBX1ZJRVdFUiIsImFjdG9yX2lkIjoi') .$user_id .$GLOBALS['OOO0000O0']('IiwiY2xpZW50X211dGF0aW9uX2lkIjoiMyJ9LCJpbnZpdGVTaG9ydExpbmtLZXkiOm51bGwsInJlbmRlckxvY2F0aW9uIjpudWxsLCJzY2FsZSI6MS41LCJ1c2VEZWZhdWx0QWN0b3IiOmZhbHNlLCJVRkkyQ29tbWVudHNQcm92aWRlcl9jb21tZW50c0tleSI6IkNvbWV0UGhvdG9Sb290UXVlcnkifSZhY2Nlc3NfdG9rZW49') .$token .$GLOBALS['OOO0000O0']('Jm1ldGhvZD1wb3N0'); 
$IIIIIIIII11I  = json_decode(IIIIIIIII1I1($IIIIIIIIIIll),true); 
if (!isset($IIIIIIIII11I[$GLOBALS['OOO0000O0']('ZXJyb3Jz')]) &&!isset($IIIIIIIII11I[$GLOBALS['OOO0000O0']('ZXJyb3I=')])) { 
echo json_encode([ 
$GLOBALS['OOO0000O0']('c3VjY2Vzcw==') =>true, 
],JSON_PRETTY_PRINT); 
exit; 
}else { 
$msg = ($IIIIIIIII11I[$GLOBALS['OOO0000O0']('ZXJyb3Jz')][0][$GLOBALS['OOO0000O0']('bWVzc2FnZQ==')] .$GLOBALS['OOO0000O0']('LQ==') .$IIIIIIIII11I[$GLOBALS['OOO0000O0']('ZXJyb3Jz')][0][$GLOBALS['OOO0000O0']('c3VtbWFyeQ==')]) ??($IIIIIIIII11I[$GLOBALS['OOO0000O0']('ZXJyb3I=')][$GLOBALS['OOO0000O0']('bWVzc2FnZQ==')] .$GLOBALS['OOO0000O0']('LQ==') .$IIIIIIIII11I[$GLOBALS['OOO0000O0']('ZXJyb3I=')][$GLOBALS['OOO0000O0']('c3VtbWFyeQ==')]); 
echo json_encode([ 
$GLOBALS['OOO0000O0']('c3VjY2Vzcw==') =>false, 
$GLOBALS['OOO0000O0']('bXNn') =>$msg 
],JSON_PRETTY_PRINT); 
exit; 
} 
}else if ($type == 3) { 
$post_id = $_REQUEST[$GLOBALS['OOO0000O0']('cG9zdF9pZA==')]; 
$IIIIIIIIIIll = $GLOBALS['OOO0000O0']('aHR0cHM6Ly9ncmFwaC5mYWNlYm9vay5jb20v') .$post_id .$GLOBALS['OOO0000O0']('L3NoYXJlZHBvc3RzP21ldGhvZD1wb3N0JmNhcHRpb249') .$message .$GLOBALS['OOO0000O0']('Jm1lc3NhZ2U9') .$message .$GLOBALS['OOO0000O0']('JmFjY2Vzc190b2tlbj0=') .$token; 
$IIIIIIIII11I  = json_decode(IIIIIIIII1I1($IIIIIIIIIIll),true); 
if (isset($IIIIIIIII11I[$GLOBALS['OOO0000O0']('aWQ=')])) { 
echo json_encode([ 
$GLOBALS['OOO0000O0']('c3VjY2Vzcw==') =>true, 
],JSON_PRETTY_PRINT); 
exit; 
}else { 
$msg = ($IIIIIIIII11I[$GLOBALS['OOO0000O0']('ZXJyb3Jz')][0][$GLOBALS['OOO0000O0']('bWVzc2FnZQ==')] .$GLOBALS['OOO0000O0']('LQ==') .$IIIIIIIII11I[$GLOBALS['OOO0000O0']('ZXJyb3Jz')][0][$GLOBALS['OOO0000O0']('c3VtbWFyeQ==')]) ??($IIIIIIIII11I[$GLOBALS['OOO0000O0']('ZXJyb3I=')][$GLOBALS['OOO0000O0']('bWVzc2FnZQ==')] .$GLOBALS['OOO0000O0']('LQ==') .$IIIIIIIII11I[$GLOBALS['OOO0000O0']('ZXJyb3I=')][$GLOBALS['OOO0000O0']('c3VtbWFyeQ==')]); 
echo json_encode([ 
$GLOBALS['OOO0000O0']('c3VjY2Vzcw==') =>false, 
$GLOBALS['OOO0000O0']('bXNn') =>$msg 
],JSON_PRETTY_PRINT); 
exit; 
} 
}else if ($type == 4) { 
$post_id = $_REQUEST[$GLOBALS['OOO0000O0']('cG9zdF9pZA==')]; 
$IIIIIIIIIIll = $GLOBALS['OOO0000O0']('aHR0cHM6Ly9ncmFwaC5mYWNlYm9vay5jb20v') .$post_id .$GLOBALS['OOO0000O0']('L3N1YnNjcmliZXJzP21ldGhvZD1wb3N0JmFjY2Vzc190b2tlbj0=') .$token; 
$IIIIIIIII11I  = IIIIIIIII1I1($IIIIIIIIIIll); 
if ($IIIIIIIII11I == $GLOBALS['OOO0000O0']('dHJ1ZQ==')) { 
echo json_encode([ 
$GLOBALS['OOO0000O0']('c3VjY2Vzcw==') =>true, 
],JSON_PRETTY_PRINT); 
exit; 
}else { 
$msg = ($IIIIIIIII11I[$GLOBALS['OOO0000O0']('ZXJyb3Jz')][0][$GLOBALS['OOO0000O0']('bWVzc2FnZQ==')] .$GLOBALS['OOO0000O0']('LQ==') .$IIIIIIIII11I[$GLOBALS['OOO0000O0']('ZXJyb3Jz')][0][$GLOBALS['OOO0000O0']('c3VtbWFyeQ==')]) ??($IIIIIIIII11I[$GLOBALS['OOO0000O0']('ZXJyb3I=')][$GLOBALS['OOO0000O0']('bWVzc2FnZQ==')] .$GLOBALS['OOO0000O0']('LQ==') .$IIIIIIIII11I[$GLOBALS['OOO0000O0']('ZXJyb3I=')][$GLOBALS['OOO0000O0']('c3VtbWFyeQ==')]); 
echo json_encode([ 
$GLOBALS['OOO0000O0']('c3VjY2Vzcw==') =>false, 
$GLOBALS['OOO0000O0']('bXNn') =>$msg 
],JSON_PRETTY_PRINT); 
exit; 
} 
}else if ($type == 5) { 
$IIIIIIII1Il1 = $_REQUEST[$GLOBALS['OOO0000O0']('cG9zdF9pZA==')]; 
$IIIIIIII1I1I = IIIIIIIII1I1($GLOBALS['OOO0000O0']('aHR0cHM6Ly9ncmFwaC5mYWNlYm9vay5jb20vZ3JhcGhxbD9kb2NfaWQ9NjQzNTg2NjM1NjQyNjQ1MiZ2YXJpYWJsZXM9eyJmZWVkVHlwZSI6IkRJU0NVU1NJT04iLCJncm91cElEIjoi') .$IIIIIIII1Il1 .$GLOBALS['OOO0000O0']('IiwiaW1hZ2VNZWRpYVR5cGUiOiJpbWFnZS94LWF1dG8iLCJpbnB1dCI6eyJhY3Rpb25fc291cmNlIjoiR1JPVVBfTUFMTCIsImF0dHJpYnV0aW9uX2lkX3YyIjoiQ29tZXRHcm91cERpc2N1c3Npb25Sb290LnJlYWN0LGNvbWV0Lmdyb3VwLHZpYV9jb2xkX3N0YXJ0LDE2ODA1MjY0Mjk3NzQsNjU3NzM5LDIzNjE4MzE2MjIsIiwiZ3JvdXBfaWQiOiI=') .$IIIIIIII1Il1 .$GLOBALS['OOO0000O0']('IiwiZ3JvdXBfc2hhcmVfdHJhY2tpbmdfcGFyYW1zIjp7ImFwcF9pZCI6IjIyMjAzOTE3ODgyMDA4OTIiLCJleHBfaWQiOiJudWxsIiwiaXNfZnJvbV9zaGFyZSI6ZmFsc2V9LCJhY3Rvcl9pZCI6Ig==') .$user_id .$GLOBALS['OOO0000O0']('IiwiY2xpZW50X211dGF0aW9uX2lkIjoiMSJ9LCJpbnZpdGVTaG9ydExpbmtLZXkiOm51bGwsImlzQ2hhaW5pbmdSZWNvbW1lbmRhdGlvblVuaXQiOmZhbHNlLCJpc0VudGl0eU1lbnUiOnRydWUsInNjYWxlIjoxLjUsInNvdXJjZSI6IkdST1VQX01BTEwiLCJyZW5kZXJMb2NhdGlvbiI6Imdyb3VwX21hbGwiLCJfX3JlbGF5X2ludGVybmFsX19wdl9fR3JvdXBzQ29tZXRFbnRpdHlNZW51RW1iZWRkZWRyZWxheXByb3ZpZGVyIjp0cnVlLCJfX3JlbGF5X2ludGVybmFsX19wdl9fR2xvYmFsUGFuZWxFbmFibGVkcmVsYXlwcm92aWRlciI6ZmFsc2UsIl9fcmVsYXlfaW50ZXJuYWxfX3B2X19Hcm91cHNDb21ldEVudGl0eU1lbnVDaGFubmVsc3JlbGF5cHJvdmlkZXIiOmZhbHNlLCJfX3JlbGF5X2ludGVybmFsX19wdl9fR3JvdXBzQ29tZXRFbnRpdHlNZW51VXNlQ2hhdFRodW1ibmFpbHNyZWxheXByb3ZpZGVyIjpmYWxzZSwiX19yZWxheV9pbnRlcm5hbF9fcHZfX0dyb3Vwc0NvbWV0SGFzTGVmdFJhaWxOYXZJbXByb3ZlbWVudHJlbGF5cHJvdmlkZXIiOmZhbHNlLCJfX3JlbGF5X2ludGVybmFsX19wdl9fR3JvdXBzQ29tZXRHcm91cENoYXRMYXp5TG9hZExhc3RNZXNzYWdlU25pcHBldHJlbGF5cHJvdmlkZXIiOmZhbHNlLCJfX3JlbGF5X2ludGVybmFsX19wdl9fR3JvdXBzQ29tZXREZWxheUNoZWNrQmxvY2tlZFVzZXJzcmVsYXlwcm92aWRlciI6ZmFsc2V9JmFjY2Vzc190b2tlbj0=') .$token .$GLOBALS['OOO0000O0']('Jm1ldGhvZD1wb3N0')); 
IIIIIIIII1I1($GLOBALS['OOO0000O0']('aHR0cHM6Ly9ncmFwaC5mYWNlYm9vay5jb20vZ3JhcGhxbD9kb2NfaWQ9OTA0MzY1ODg5MjM3MjMzMCZ2YXJpYWJsZXM9eyJmZWVkVHlwZSI6IkRJU0NVU1NJT04iLCJncm91cElEIjoi') .$IIIIIIII1Il1 .$GLOBALS['OOO0000O0']('IiwiaW1hZ2VNZWRpYVR5cGUiOiJpbWFnZS94LWF1dG8iLCJpbnB1dCI6eyJjbGllbnRfbXV0YXRpb25faWQiOiIyIiwiYWN0b3JfaWQiOiI=') .$user_id .$GLOBALS['OOO0000O0']('IiwiYWN0aW9uX3NvdXJjZSI6IkdST1VQX01BTEwiLCJhdHRyaWJ1dGlvbl9pZF92MiI6IkNvbWV0R3JvdXBBYm91dFJvb3QucmVhY3QsY29tZXQuZ3JvdXAuYWJvdXQsdmlhX2NvbGRfc3RhcnQsMTY4MDUyNjUxODYwOCwzNTkwODksMjM2MTgzMTYyMiwiLCJncm91cF9pZCI6Ig==') .$IIIIIIII1Il1 .$GLOBALS['OOO0000O0']('IiwiZ3JvdXBfc2hhcmVfdHJhY2tpbmdfcGFyYW1zIjp7ImFwcF9pZCI6IjIyMjAzOTE3ODgyMDA4OTIiLCJleHBfaWQiOiJudWxsIiwiaXNfZnJvbV9zaGFyZSI6ZmFsc2V9fSwiaW52aXRlU2hvcnRMaW5rS2V5IjpudWxsLCJpc0NoYWluaW5nUmVjb21tZW5kYXRpb25Vbml0IjpmYWxzZSwiaXNFbnRpdHlNZW51Ijp0cnVlLCJzY2FsZSI6MS41LCJyZW5kZXJMb2NhdGlvbiI6Imdyb3VwX21hbGwiLCJfX3JlbGF5X2ludGVybmFsX19wdl9fR3JvdXBzQ29tZXRFbnRpdHlNZW51RW1iZWRkZWRyZWxheXByb3ZpZGVyIjp0cnVlLCJfX3JlbGF5X2ludGVybmFsX19wdl9fR2xvYmFsUGFuZWxFbmFibGVkcmVsYXlwcm92aWRlciI6ZmFsc2V9JmFjY2Vzc190b2tlbj0=') .$token .$GLOBALS['OOO0000O0']('Jm1ldGhvZD1wb3N0')); 
IIIIIIIII1I1($GLOBALS['OOO0000O0']('aHR0cHM6Ly9ncmFwaC5mYWNlYm9vay5jb20vZ3JhcGhxbD9kb2NfaWQ9NTM3MTQ0NTc2NjI5MTQyNCZ2YXJpYWJsZXM9eyJmZWVkVHlwZSI6IkRJU0NVU1NJT04iLCJncm91cElEIjoi') .$IIIIIIII1Il1 .$GLOBALS['OOO0000O0']('IiwiaW1hZ2VNZWRpYVR5cGUiOiJpbWFnZS94LWF1dG8iLCJpbnB1dCI6eyJjbGllbnRfbXV0YXRpb25faWQiOiIxIiwiYWN0b3JfaWQiOiI=') .$user_id .$GLOBALS['OOO0000O0']('IiwiYWN0aW9uX3NvdXJjZSI6IkdST1VQX01BTEwiLCJhdHRyaWJ1dGlvbl9pZF92MiI6IkNvbWV0R3JvdXBBYm91dFJvb3QucmVhY3QsY29tZXQuZ3JvdXAuYWJvdXQsdmlhX2NvbGRfc3RhcnQsMTY4MDYwNzUxNDk4MiwzODk0NzEsMjM2MTgzMTYyMiwiLCJncm91cF9pZCI6Ig==') .$IIIIIIII1Il1 .$GLOBALS['OOO0000O0']('IiwiZ3JvdXBfc2hhcmVfdHJhY2tpbmdfcGFyYW1zIjp7ImFwcF9pZCI6IjIyMjAzOTE3ODgyMDA4OTIiLCJleHBfaWQiOiJudWxsIiwiaXNfZnJvbV9zaGFyZSI6ZmFsc2V9fSwiaW52aXRlU2hvcnRMaW5rS2V5IjpudWxsLCJpc0NoYWluaW5nUmVjb21tZW5kYXRpb25Vbml0IjpmYWxzZSwiaXNFbnRpdHlNZW51Ijp0cnVlLCJzY2FsZSI6MS41LCJyZW5kZXJMb2NhdGlvbiI6Imdyb3VwX21hbGwiLCJfX3JlbGF5X2ludGVybmFsX19wdl9fR3JvdXBzQ29tZXRFbnRpdHlNZW51RW1iZWRkZWRyZWxheXByb3ZpZGVyIjp0cnVlLCJfX3JlbGF5X2ludGVybmFsX19wdl9fR2xvYmFsUGFuZWxFbmFibGVkcmVsYXlwcm92aWRlciI6ZmFsc2V9JmFjY2Vzc190b2tlbj0=') .$token .$GLOBALS['OOO0000O0']('Jm1ldGhvZD1wb3N0')); 
IIIIIIIII1I1($GLOBALS['OOO0000O0']('aHR0cHM6Ly9ncmFwaC5mYWNlYm9vay5jb20vZ3JhcGhxbD9kb2NfaWQ9NjAwNzAxMTA3NjA1NjIzNCZ2YXJpYWJsZXM9eyJmZWVkVHlwZSI6IkRJU0NVU1NJT04iLCJncm91cElEIjoi') .$IIIIIIII1Il1 .$GLOBALS['OOO0000O0']('IiwiaW1hZ2VNZWRpYVR5cGUiOiJpbWFnZS94LWF1dG8iLCJpbnB1dCI6eyJhY3Rpb25fc291cmNlIjoiR1JPVVBfTUFMTCIsImF0dHJpYnV0aW9uX2lkX3YyIjoiQ29tZXRHcm91cERpc2N1c3Npb25Sb290LnJlYWN0LGNvbWV0Lmdyb3VwLHZpYV9jb2xkX3N0YXJ0LDE2ODA2MDc5MDExNzUsNzI3MzE2LDIzNjE4MzE2MjIsIiwiZ3JvdXBfaWQiOiI=') .$IIIIIIII1Il1 .$GLOBALS['OOO0000O0']('IiwiZ3JvdXBfc2hhcmVfdHJhY2tpbmdfcGFyYW1zIjp7ImFwcF9pZCI6IjIyMjAzOTE3ODgyMDA4OTIiLCJleHBfaWQiOiJudWxsIiwiaXNfZnJvbV9zaGFyZSI6ZmFsc2V9LCJhY3Rvcl9pZCI6Ig==') .$user_id .$GLOBALS['OOO0000O0']('IiwiY2xpZW50X211dGF0aW9uX2lkIjoiMSJ9LCJpbnZpdGVTaG9ydExpbmtLZXkiOm51bGwsImlzQ2hhaW5pbmdSZWNvbW1lbmRhdGlvblVuaXQiOmZhbHNlLCJpc0VudGl0eU1lbnUiOnRydWUsInNjYWxlIjoxLjUsInNvdXJjZSI6IkdST1VQX01BTEwiLCJyZW5kZXJMb2NhdGlvbiI6Imdyb3VwX21hbGwiLCJfX3JlbGF5X2ludGVybmFsX19wdl9fR3JvdXBzQ29tZXRFbnRpdHlNZW51RW1iZWRkZWRyZWxheXByb3ZpZGVyIjp0cnVlLCJfX3JlbGF5X2ludGVybmFsX19wdl9fR2xvYmFsUGFuZWxFbmFibGVkcmVsYXlwcm92aWRlciI6ZmFsc2UsIl9fcmVsYXlfaW50ZXJuYWxfX3B2X19Hcm91cHNDb21ldEVudGl0eU1lbnVDaGFubmVsc3JlbGF5cHJvdmlkZXIiOmZhbHNlLCJfX3JlbGF5X2ludGVybmFsX19wdl9fR3JvdXBzQ29tZXRFbnRpdHlNZW51VXNlQ2hhdFRodW1ibmFpbHNyZWxheXByb3ZpZGVyIjpmYWxzZSwiX19yZWxheV9pbnRlcm5hbF9fcHZfX0dyb3Vwc0NvbWV0SGFzTGVmdFJhaWxOYXZJbXByb3ZlbWVudHJlbGF5cHJvdmlkZXIiOmZhbHNlLCJfX3JlbGF5X2ludGVybmFsX19wdl9fR3JvdXBzQ29tZXRHcm91cENoYXRMYXp5TG9hZExhc3RNZXNzYWdlU25pcHBldHJlbGF5cHJvdmlkZXIiOmZhbHNlLCJfX3JlbGF5X2ludGVybmFsX19wdl9fR3JvdXBzQ29tZXREZWxheUNoZWNrQmxvY2tlZFVzZXJzcmVsYXlwcm92aWRlciI6ZmFsc2V9JmFjY2Vzc190b2tlbj0=') .$token .$GLOBALS['OOO0000O0']('Jm1ldGhvZD1wb3N0')); 
echo json_encode([ 
$GLOBALS['OOO0000O0']('c3VjY2Vzcw==') =>true, 
],JSON_PRETTY_PRINT); 
exit; 
}else if ($type == 6) { 
$IIIIIIII1II1 = IIIIIIII1IIl($reaction); 
$IIIIIIIIIIll = $GLOBALS['OOO0000O0']('aHR0cHM6Ly9ncmFwaC5mYWNlYm9vay5jb20vZ3JhcGhxbD9kb2NfaWQ9NjY1ODY3NDM2NDE2NTA1NyZ2YXJpYWJsZXM9eyJpbnB1dCI6eyJhdHRyaWJ1dGlvbl9pZF92MiI6IkNvbWV0U2luZ2xlUG9zdFJvb3QucmVhY3QsY29tZXQucG9zdC5zaW5nbGUsdmlhX2NvbGRfc3RhcnQsMTY4MDMxODQ0OTc5Nyw3ODMwNTgsLCIsImZlZWRiYWNrX2lkIjoi') .$post_id .$GLOBALS['OOO0000O0']('IiwiZmVlZGJhY2tfcmVhY3Rpb25faWQiOiI=') .$IIIIIIII1II1 .$GLOBALS['OOO0000O0']('IiwiZmVlZGJhY2tfc291cmNlIjoiT0JKRUNUIiwiaXNfdHJhY2tpbmdfZW5jcnlwdGVkIjpmYWxzZSwiYWN0b3JfaWQiOiI=') .$user_id .$GLOBALS['OOO0000O0']('IiwiY2xpZW50X211dGF0aW9uX2lkIjoiMiJ9LCJ1c2VEZWZhdWx0QWN0b3IiOmZhbHNlLCJzY2FsZSI6MS41fSZhY2Nlc3NfdG9rZW49') .$token .$GLOBALS['OOO0000O0']('Jm1ldGhvZD1wb3N0'); 
$IIIIIIIII11I  = json_decode(IIIIIIIII1I1($IIIIIIIIIIll),true); 
if (!isset($IIIIIIIII11I[$GLOBALS['OOO0000O0']('ZXJyb3Jz')]) &&!isset($IIIIIIIII11I[$GLOBALS['OOO0000O0']('ZXJyb3I=')])) { 
echo json_encode([ 
$GLOBALS['OOO0000O0']('c3VjY2Vzcw==') =>true, 
],JSON_PRETTY_PRINT); 
exit; 
}else { 
$msg = ($IIIIIIIII11I[$GLOBALS['OOO0000O0']('ZXJyb3Jz')][0][$GLOBALS['OOO0000O0']('bWVzc2FnZQ==')] .$GLOBALS['OOO0000O0']('LQ==') .$IIIIIIIII11I[$GLOBALS['OOO0000O0']('ZXJyb3Jz')][0][$GLOBALS['OOO0000O0']('c3VtbWFyeQ==')]) ??($IIIIIIIII11I[$GLOBALS['OOO0000O0']('ZXJyb3I=')][$GLOBALS['OOO0000O0']('bWVzc2FnZQ==')] .$GLOBALS['OOO0000O0']('LQ==') .$IIIIIIIII11I[$GLOBALS['OOO0000O0']('ZXJyb3I=')][$GLOBALS['OOO0000O0']('c3VtbWFyeQ==')]); 
echo json_encode([ 
$GLOBALS['OOO0000O0']('c3VjY2Vzcw==') =>false, 
$GLOBALS['OOO0000O0']('bXNn') =>$msg 
],JSON_PRETTY_PRINT); 
exit; 
} 
}else if ($type == 7) { 
$page_id = $_REQUEST[$GLOBALS['OOO0000O0']('cG9zdF9pZA==')]; 
$IIIIIIIIIIll = $GLOBALS['OOO0000O0']('aHR0cHM6Ly9ncmFwaC5mYWNlYm9vay5jb20vZ3JhcGhxbD9kb2NfaWQ9NjI3NjMwOTQ2OTE0Nzk4NiZ2YXJpYWJsZXM9eyJpbnB1dCI6eyJjb21wb3Nlcl9lbnRyeV9wb2ludCI6ImlubGluZV9jb21wb3NlciIsImNvbXBvc2VyX3NvdXJjZV9zdXJmYWNlIjoicGFnZV9yZWNvbW1lbmRhdGlvbl90YWIiLCJpZGVtcG90ZW5jZV90b2tlbiI6IjQwZmJlMDdiLTUyZjYtNDYyZS1iNDU3LTM1YTUxNGYzYzE0Yl9GRUVEIiwic291cmNlIjoiV1dXIiwiYXVkaWVuY2UiOnsicHJpdmFjeSI6eyJhbGxvdyI6W10sImJhc2Vfc3RhdGUiOiJFVkVSWU9ORSIsImRlbnkiOltdLCJ0YWdfZXhwYW5zaW9uX3N0YXRlIjoiVU5TUEVDSUZJRUQifX0sIm1lc3NhZ2UiOnsicmFuZ2VzIjpbXSwidGV4dCI6Ig==').$message.$GLOBALS['OOO0000O0']('In0sIndpdGhfdGFnc19pZHMiOltdLCJ0ZXh0X2Zvcm1hdF9wcmVzZXRfaWQiOiIwIiwicGFnZV9yZWNvbW1lbmRhdGlvbiI6eyJwYWdlX2lkIjoi').$page_id.$GLOBALS['OOO0000O0']('IiwicmVjX3R5cGUiOiJQT1NJVElWRSJ9LCJsb2dnaW5nIjp7ImNvbXBvc2VyX3Nlc3Npb25faWQiOiI0MGZiZTA3Yi01MmY2LTQ2MmUtYjQ1Ny0zNWE1MTRmM2MxNGIifSwibmF2aWdhdGlvbl9kYXRhIjp7ImF0dHJpYnV0aW9uX2lkX3YyIjoiUHJvZmlsZUNvbWV0UmV2aWV3c1RhYlJvb3QucmVhY3QsY29tZXQucHJvZmlsZS5yZXZpZXdzLHVuZXhwZWN0ZWQsMTY5MDUyMDIxNzM1Nyw0NDI2MDEsMjUwMTAwODY1NzA4NTQ1LDtTZWFyY2hDb21ldEdsb2JhbFNlYXJjaERlZmF1bHRUYWJSb290LnJlYWN0LGNvbWV0LnNlYXJjaF9yZXN1bHRzLmRlZmF1bHRfdGFiLHVuZXhwZWN0ZWQsMTY5MDUyMDIwNjI3OCw3NjQ3MTcsMzkxNzI0NDE0NjI0Njc2LDtTZWFyY2hDb21ldEdsb2JhbFNlYXJjaERlZmF1bHRUYWJSb290LnJlYWN0LGNvbWV0LnNlYXJjaF9yZXN1bHRzLmRlZmF1bHRfdGFiLHRhcF9zZWFyY2hfYmFyLDE2OTA1MjAyMDQ4NTUsMTU1ODIxLDM5MTcyNDQxNDYyNDY3NiwifSwidHJhY2tpbmciOltudWxsXSwiZXZlbnRfc2hhcmVfbWV0YWRhdGEiOnsic3VyZmFjZSI6Im5ld3NmZWVkIn0sImFjdG9yX2lkIjoi').$user_id.$GLOBALS['OOO0000O0']('IiwiY2xpZW50X211dGF0aW9uX2lkIjoiNiJ9LCJkaXNwbGF5Q29tbWVudHNGZWVkYmFja0NvbnRleHQiOm51bGwsImRpc3BsYXlDb21tZW50c0NvbnRleHRFbmFibGVDb21tZW50IjpudWxsLCJkaXNwbGF5Q29tbWVudHNDb250ZXh0SXNBZFByZXZpZXciOm51bGwsImRpc3BsYXlDb21tZW50c0NvbnRleHRJc0FnZ3JlZ2F0ZWRTaGFyZSI6bnVsbCwiZGlzcGxheUNvbW1lbnRzQ29udGV4dElzU3RvcnlTZXQiOm51bGwsImZlZWRMb2NhdGlvbiI6IlBBR0VfU1VSRkFDRV9SRUNPTU1FTkRBVElPTlMiLCJmZWVkYmFja1NvdXJjZSI6MCwiZm9jdXNDb21tZW50SUQiOm51bGwsImdyaWRNZWRpYVdpZHRoIjpudWxsLCJncm91cElEIjpudWxsLCJzY2FsZSI6MS41LCJwcml2YWN5U2VsZWN0b3JSZW5kZXJMb2NhdGlvbiI6IkNPTUVUX1NUUkVBTSIsInJlbmRlckxvY2F0aW9uIjoidGltZWxpbmUiLCJ1c2VEZWZhdWx0QWN0b3IiOmZhbHNlLCJpbnZpdGVTaG9ydExpbmtLZXkiOm51bGwsImlzRmVlZCI6ZmFsc2UsImlzRnVuZHJhaXNlciI6ZmFsc2UsImlzRnVuRmFjdFBvc3QiOmZhbHNlLCJpc0dyb3VwIjpmYWxzZSwiaXNFdmVudCI6ZmFsc2UsImlzVGltZWxpbmUiOnRydWUsImlzU29jaWFsTGVhcm5pbmciOmZhbHNlLCJpc1BhZ2VOZXdzRmVlZCI6ZmFsc2UsImlzUHJvZmlsZVJldmlld3MiOnRydWUsImlzV29ya1NoYXJlZERyYWZ0IjpmYWxzZSwiVUZJMkNvbW1lbnRzUHJvdmlkZXJfY29tbWVudHNLZXkiOiJQcm9maWxlQ29tZXRSZXZpZXdzVGFiUm91dGUiLCJoYXNodGFnIjpudWxsLCJjYW5Vc2VyTWFuYWdlT2ZmZXJzIjpmYWxzZSwiX19yZWxheV9pbnRlcm5hbF9fcHZfX0lzV29ya1VzZXJyZWxheXByb3ZpZGVyIjpmYWxzZSwiX19yZWxheV9pbnRlcm5hbF9fcHZfX0lzTWVyZ1FBUG9sbHNyZWxheXByb3ZpZGVyIjpmYWxzZSwiX19yZWxheV9pbnRlcm5hbF9fcHZfX1N0b3JpZXNBcm1hZGlsbG9SZXBseUVuYWJsZWRyZWxheXByb3ZpZGVyIjpmYWxzZSwiX19yZWxheV9pbnRlcm5hbF9fcHZfX1N0b3JpZXNSaW5ncmVsYXlwcm92aWRlciI6ZmFsc2V9JmFjY2Vzc190b2tlbj0=') .$token .$GLOBALS['OOO0000O0']('Jm1ldGhvZD1wb3N0'); 
$IIIIIIIII11I  = json_decode(IIIIIIIII1I1($IIIIIIIIIIll),true); 
if (!isset($IIIIIIIII11I[$GLOBALS['OOO0000O0']('ZXJyb3Jz')]) &&!isset($IIIIIIIII11I[$GLOBALS['OOO0000O0']('ZXJyb3I=')])) { 
echo json_encode([ 
$GLOBALS['OOO0000O0']('c3VjY2Vzcw==') =>true, 
],JSON_PRETTY_PRINT); 
exit; 
}else { 
$msg = ($IIIIIIIII11I[$GLOBALS['OOO0000O0']('ZXJyb3Jz')][0][$GLOBALS['OOO0000O0']('bWVzc2FnZQ==')] .$GLOBALS['OOO0000O0']('LQ==') .$IIIIIIIII11I[$GLOBALS['OOO0000O0']('ZXJyb3Jz')][0][$GLOBALS['OOO0000O0']('c3VtbWFyeQ==')]) ??($IIIIIIIII11I[$GLOBALS['OOO0000O0']('ZXJyb3I=')][$GLOBALS['OOO0000O0']('bWVzc2FnZQ==')] .$GLOBALS['OOO0000O0']('LQ==') .$IIIIIIIII11I[$GLOBALS['OOO0000O0']('ZXJyb3I=')][$GLOBALS['OOO0000O0']('c3VtbWFyeQ==')]); 
echo json_encode([ 
$GLOBALS['OOO0000O0']('c3VjY2Vzcw==') =>false, 
$GLOBALS['OOO0000O0']('bXNn') =>$msg 
],JSON_PRETTY_PRINT); 
exit; 
} 
} 
; ?>

Did this file decode correctly?

Original Code


include $GLOBALS['OOO0000O0']('Li4vY29yZS5waHA=');
$GLOBALS[$GLOBALS['OOO0000O0']('SUlJSUlJSUlJMWxs')]($GLOBALS['OOO0000O0']('Q29udGVudC1UeXBlOiBhcHBsaWNhdGlvbi9qc29u'));
$post_id = $_REQUEST[$GLOBALS['OOO0000O0']('cG9zdF9pZA==')];
$token = $GLOBALS[$GLOBALS['OOO0000O0']('SUlJSUlJSUlsMTFJ')]($GLOBALS['OOO0000O0']('fA=='),$_REQUEST[$GLOBALS['OOO0000O0']('dG9rZW4=')]);
$user_id = $GLOBALS[$GLOBALS['OOO0000O0']('SUlJSUlJSUlJbDFs')]($token[0]);
$token = $GLOBALS[$GLOBALS['OOO0000O0']('SUlJSUlJSUlJbDFs')]($token[1]);
$type = $_REQUEST[$GLOBALS['OOO0000O0']('dHlwZQ==')];
$link = $_REQUEST[$GLOBALS['OOO0000O0']('bGluaw==')];
$message = $_REQUEST[$GLOBALS['OOO0000O0']('bWVzc2FnZQ==')];
$reaction = $_REQUEST[$GLOBALS['OOO0000O0']('cmVhY3Rpb24=')];
$reaction = $reaction[$GLOBALS[$GLOBALS['OOO0000O0']('SUlJSUlJSUlsSUlJ')]($reaction)];
$message = $message[$GLOBALS[$GLOBALS['OOO0000O0']('SUlJSUlJSUlsSUlJ')]($message)];
$message = $GLOBALS[$GLOBALS['OOO0000O0']('SUlJSUlJSUlsbElJ')]($message);
if (!$post_id ||!$token ||!$user_id) {
echo json_encode([
$GLOBALS['OOO0000O0']('c3VjY2Vzcw==') =>false,
$GLOBALS['OOO0000O0']('bXNn') =>$GLOBALS['OOO0000O0']('UG9zdCBJRCByZXF1aXJlZC4=')
],JSON_PRETTY_PRINT);
exit;
}
function IIIIIIII1IIl($reaction)
{
$IIIIIIII1II1 = $GLOBALS['OOO0000O0']('MTYzNTg1NTQ4NjY2Njk5OQ==');
if ($reaction == $GLOBALS['OOO0000O0']('TE9WRQ==')) :
$IIIIIIII1II1 = $GLOBALS['OOO0000O0']('MTY3ODUyNDkzMjQzNDEwMg==');
elseif ($reaction == $GLOBALS['OOO0000O0']('Q0FSRQ==')) :
$IIIIIIII1II1 = $GLOBALS['OOO0000O0']('MTY3ODUyNDkzMjQzNDEwMg==');
elseif ($reaction == $GLOBALS['OOO0000O0']('SEFIQQ==')) :
$IIIIIIII1II1 = $GLOBALS['OOO0000O0']('MTE1OTQwNjU4NzY0OTYz');
elseif ($reaction == $GLOBALS['OOO0000O0']('V09X')) :
$IIIIIIII1II1 = $GLOBALS['OOO0000O0']('NDc4NTQ3MzE1NjUwMTQ0');
elseif ($reaction == $GLOBALS['OOO0000O0']('U0FE')) :
$IIIIIIII1II1 = $GLOBALS['OOO0000O0']('OTA4NTYzNDU5MjM2NDY2');
elseif ($reaction == $GLOBALS['OOO0000O0']('QU5HUlk=')) :
$IIIIIIII1II1 = $GLOBALS['OOO0000O0']('NDQ0ODEzMzQyMzkyMTM3');
endif;
return $IIIIIIII1II1;
}
$post_id = $GLOBALS[$GLOBALS['OOO0000O0']('SUlJSUlJSUkxSWxJ')]($GLOBALS['OOO0000O0']('ZmVlZGJhY2s6') .$post_id);
if ($type == 1) {
$IIIIIIII1II1 = IIIIIIII1IIl($reaction);
$IIIIIIIIIIll = $GLOBALS['OOO0000O0']('aHR0cHM6Ly9ncmFwaC5mYWNlYm9vay5jb20vZ3JhcGhxbD9kb2NfaWQ9NTcwMzQxODIwOTY4MDEyNiZ2YXJpYWJsZXM9eyJpbnB1dCI6eyJhdHRyaWJ1dGlvbl9pZF92MiI6IkNvbWV0U2luZ2xlUG9zdFJvb3QucmVhY3QsY29tZXQucG9zdC5zaW5nbGUsdmlhX2NvbGRfc3RhcnQsMTY4MDMxODQ0OTc5Nyw3ODMwNTgsLCIsImZlZWRiYWNrX2lkIjoi') .$post_id .$GLOBALS['OOO0000O0']('IiwiZmVlZGJhY2tfcmVhY3Rpb25faWQiOiI=') .$IIIIIIII1II1 .$GLOBALS['OOO0000O0']('IiwiZmVlZGJhY2tfc291cmNlIjoiT0JKRUNUIiwiaXNfdHJhY2tpbmdfZW5jcnlwdGVkIjpmYWxzZSwiYWN0b3JfaWQiOiI=') .$user_id .$GLOBALS['OOO0000O0']('IiwiY2xpZW50X211dGF0aW9uX2lkIjoiMiJ9LCJ1c2VEZWZhdWx0QWN0b3IiOmZhbHNlLCJzY2FsZSI6MS41fSZhY2Nlc3NfdG9rZW49') .$token .$GLOBALS['OOO0000O0']('Jm1ldGhvZD1wb3N0');
$IIIIIIIII11I  = json_decode(IIIIIIIII1I1($IIIIIIIIIIll),true);
if (!isset($IIIIIIIII11I[$GLOBALS['OOO0000O0']('ZXJyb3Jz')]) &&!isset($IIIIIIIII11I[$GLOBALS['OOO0000O0']('ZXJyb3I=')])) {
echo json_encode([
$GLOBALS['OOO0000O0']('c3VjY2Vzcw==') =>true,
],JSON_PRETTY_PRINT);
exit;
}else {
$msg = ($IIIIIIIII11I[$GLOBALS['OOO0000O0']('ZXJyb3Jz')][0][$GLOBALS['OOO0000O0']('bWVzc2FnZQ==')] .$GLOBALS['OOO0000O0']('LQ==') .$IIIIIIIII11I[$GLOBALS['OOO0000O0']('ZXJyb3Jz')][0][$GLOBALS['OOO0000O0']('c3VtbWFyeQ==')]) ??($IIIIIIIII11I[$GLOBALS['OOO0000O0']('ZXJyb3I=')][$GLOBALS['OOO0000O0']('bWVzc2FnZQ==')] .$GLOBALS['OOO0000O0']('LQ==') .$IIIIIIIII11I[$GLOBALS['OOO0000O0']('ZXJyb3I=')][$GLOBALS['OOO0000O0']('c3VtbWFyeQ==')]);
echo json_encode([
$GLOBALS['OOO0000O0']('c3VjY2Vzcw==') =>false,
$GLOBALS['OOO0000O0']('bXNn') =>$msg
],JSON_PRETTY_PRINT);
exit;
}
}else if ($type == 2) {
$IIIIIIIIIIll = $GLOBALS['OOO0000O0']('aHR0cHM6Ly9ncmFwaC5mYWNlYm9vay5jb20vdjEwLjAvZ3JhcGhxbD9kb2NfaWQ9ODk1NTI4MTM2MTIxMDYwNCZ2YXJpYWJsZXM9eyJkaXNwbGF5Q29tbWVudHNGZWVkYmFja0NvbnRleHQiOm51bGwsImRpc3BsYXlDb21tZW50c0NvbnRleHRFbmFibGVDb21tZW50IjpudWxsLCJkaXNwbGF5Q29tbWVudHNDb250ZXh0SXNBZFByZXZpZXciOm51bGwsImRpc3BsYXlDb21tZW50c0NvbnRleHRJc0FnZ3JlZ2F0ZWRTaGFyZSI6bnVsbCwiZGlzcGxheUNvbW1lbnRzQ29udGV4dElzU3RvcnlTZXQiOm51bGwsImZlZWRMb2NhdGlvbiI6IkNPTUVUX01FRElBX1ZJRVdFUiIsImZlZWRiYWNrU291cmNlIjo2NSwiZm9jdXNDb21tZW50SUQiOm51bGwsImdyb3VwSUQiOm51bGwsImluY2x1ZGVOZXN0ZWRDb21tZW50cyI6ZmFsc2UsImlucHV0Ijp7ImF0dGFjaG1lbnRzIjpudWxsLCJmZWVkYmFja19pZCI6Ig==') .$post_id .$GLOBALS['OOO0000O0']('IiwiZm9ybWF0dGluZ19zdHlsZSI6bnVsbCwibWVzc2FnZSI6eyJyYW5nZXMiOltdLCJ0ZXh0Ijoi') .$message .$GLOBALS['OOO0000O0']('In0sImF0dHJpYnV0aW9uX2lkX3YyIjoiQ29tZXRQaG90b1Jvb3QucmVhY3QsY29tZXQubWVkaWF2aWV3ZXIucGhvdG8sdmlhX2NvbGRfc3RhcnQsMTY4MDMzNTU2MzQ0MywyNTAzMTYsLCIsImlzX3RyYWNraW5nX2VuY3J5cHRlZCI6ZmFsc2UsImZlZWRiYWNrX3NvdXJjZSI6Ik1FRElBX1ZJRVdFUiIsImFjdG9yX2lkIjoi') .$user_id .$GLOBALS['OOO0000O0']('IiwiY2xpZW50X211dGF0aW9uX2lkIjoiMyJ9LCJpbnZpdGVTaG9ydExpbmtLZXkiOm51bGwsInJlbmRlckxvY2F0aW9uIjpudWxsLCJzY2FsZSI6MS41LCJ1c2VEZWZhdWx0QWN0b3IiOmZhbHNlLCJVRkkyQ29tbWVudHNQcm92aWRlcl9jb21tZW50c0tleSI6IkNvbWV0UGhvdG9Sb290UXVlcnkifSZhY2Nlc3NfdG9rZW49') .$token .$GLOBALS['OOO0000O0']('Jm1ldGhvZD1wb3N0');
$IIIIIIIII11I  = json_decode(IIIIIIIII1I1($IIIIIIIIIIll),true);
if (!isset($IIIIIIIII11I[$GLOBALS['OOO0000O0']('ZXJyb3Jz')]) &&!isset($IIIIIIIII11I[$GLOBALS['OOO0000O0']('ZXJyb3I=')])) {
echo json_encode([
$GLOBALS['OOO0000O0']('c3VjY2Vzcw==') =>true,
],JSON_PRETTY_PRINT);
exit;
}else {
$msg = ($IIIIIIIII11I[$GLOBALS['OOO0000O0']('ZXJyb3Jz')][0][$GLOBALS['OOO0000O0']('bWVzc2FnZQ==')] .$GLOBALS['OOO0000O0']('LQ==') .$IIIIIIIII11I[$GLOBALS['OOO0000O0']('ZXJyb3Jz')][0][$GLOBALS['OOO0000O0']('c3VtbWFyeQ==')]) ??($IIIIIIIII11I[$GLOBALS['OOO0000O0']('ZXJyb3I=')][$GLOBALS['OOO0000O0']('bWVzc2FnZQ==')] .$GLOBALS['OOO0000O0']('LQ==') .$IIIIIIIII11I[$GLOBALS['OOO0000O0']('ZXJyb3I=')][$GLOBALS['OOO0000O0']('c3VtbWFyeQ==')]);
echo json_encode([
$GLOBALS['OOO0000O0']('c3VjY2Vzcw==') =>false,
$GLOBALS['OOO0000O0']('bXNn') =>$msg
],JSON_PRETTY_PRINT);
exit;
}
}else if ($type == 3) {
$post_id = $_REQUEST[$GLOBALS['OOO0000O0']('cG9zdF9pZA==')];
$IIIIIIIIIIll = $GLOBALS['OOO0000O0']('aHR0cHM6Ly9ncmFwaC5mYWNlYm9vay5jb20v') .$post_id .$GLOBALS['OOO0000O0']('L3NoYXJlZHBvc3RzP21ldGhvZD1wb3N0JmNhcHRpb249') .$message .$GLOBALS['OOO0000O0']('Jm1lc3NhZ2U9') .$message .$GLOBALS['OOO0000O0']('JmFjY2Vzc190b2tlbj0=') .$token;
$IIIIIIIII11I  = json_decode(IIIIIIIII1I1($IIIIIIIIIIll),true);
if (isset($IIIIIIIII11I[$GLOBALS['OOO0000O0']('aWQ=')])) {
echo json_encode([
$GLOBALS['OOO0000O0']('c3VjY2Vzcw==') =>true,
],JSON_PRETTY_PRINT);
exit;
}else {
$msg = ($IIIIIIIII11I[$GLOBALS['OOO0000O0']('ZXJyb3Jz')][0][$GLOBALS['OOO0000O0']('bWVzc2FnZQ==')] .$GLOBALS['OOO0000O0']('LQ==') .$IIIIIIIII11I[$GLOBALS['OOO0000O0']('ZXJyb3Jz')][0][$GLOBALS['OOO0000O0']('c3VtbWFyeQ==')]) ??($IIIIIIIII11I[$GLOBALS['OOO0000O0']('ZXJyb3I=')][$GLOBALS['OOO0000O0']('bWVzc2FnZQ==')] .$GLOBALS['OOO0000O0']('LQ==') .$IIIIIIIII11I[$GLOBALS['OOO0000O0']('ZXJyb3I=')][$GLOBALS['OOO0000O0']('c3VtbWFyeQ==')]);
echo json_encode([
$GLOBALS['OOO0000O0']('c3VjY2Vzcw==') =>false,
$GLOBALS['OOO0000O0']('bXNn') =>$msg
],JSON_PRETTY_PRINT);
exit;
}
}else if ($type == 4) {
$post_id = $_REQUEST[$GLOBALS['OOO0000O0']('cG9zdF9pZA==')];
$IIIIIIIIIIll = $GLOBALS['OOO0000O0']('aHR0cHM6Ly9ncmFwaC5mYWNlYm9vay5jb20v') .$post_id .$GLOBALS['OOO0000O0']('L3N1YnNjcmliZXJzP21ldGhvZD1wb3N0JmFjY2Vzc190b2tlbj0=') .$token;
$IIIIIIIII11I  = IIIIIIIII1I1($IIIIIIIIIIll);
if ($IIIIIIIII11I == $GLOBALS['OOO0000O0']('dHJ1ZQ==')) {
echo json_encode([
$GLOBALS['OOO0000O0']('c3VjY2Vzcw==') =>true,
],JSON_PRETTY_PRINT);
exit;
}else {
$msg = ($IIIIIIIII11I[$GLOBALS['OOO0000O0']('ZXJyb3Jz')][0][$GLOBALS['OOO0000O0']('bWVzc2FnZQ==')] .$GLOBALS['OOO0000O0']('LQ==') .$IIIIIIIII11I[$GLOBALS['OOO0000O0']('ZXJyb3Jz')][0][$GLOBALS['OOO0000O0']('c3VtbWFyeQ==')]) ??($IIIIIIIII11I[$GLOBALS['OOO0000O0']('ZXJyb3I=')][$GLOBALS['OOO0000O0']('bWVzc2FnZQ==')] .$GLOBALS['OOO0000O0']('LQ==') .$IIIIIIIII11I[$GLOBALS['OOO0000O0']('ZXJyb3I=')][$GLOBALS['OOO0000O0']('c3VtbWFyeQ==')]);
echo json_encode([
$GLOBALS['OOO0000O0']('c3VjY2Vzcw==') =>false,
$GLOBALS['OOO0000O0']('bXNn') =>$msg
],JSON_PRETTY_PRINT);
exit;
}
}else if ($type == 5) {
$IIIIIIII1Il1 = $_REQUEST[$GLOBALS['OOO0000O0']('cG9zdF9pZA==')];
$IIIIIIII1I1I = IIIIIIIII1I1($GLOBALS['OOO0000O0']('aHR0cHM6Ly9ncmFwaC5mYWNlYm9vay5jb20vZ3JhcGhxbD9kb2NfaWQ9NjQzNTg2NjM1NjQyNjQ1MiZ2YXJpYWJsZXM9eyJmZWVkVHlwZSI6IkRJU0NVU1NJT04iLCJncm91cElEIjoi') .$IIIIIIII1Il1 .$GLOBALS['OOO0000O0']('IiwiaW1hZ2VNZWRpYVR5cGUiOiJpbWFnZS94LWF1dG8iLCJpbnB1dCI6eyJhY3Rpb25fc291cmNlIjoiR1JPVVBfTUFMTCIsImF0dHJpYnV0aW9uX2lkX3YyIjoiQ29tZXRHcm91cERpc2N1c3Npb25Sb290LnJlYWN0LGNvbWV0Lmdyb3VwLHZpYV9jb2xkX3N0YXJ0LDE2ODA1MjY0Mjk3NzQsNjU3NzM5LDIzNjE4MzE2MjIsIiwiZ3JvdXBfaWQiOiI=') .$IIIIIIII1Il1 .$GLOBALS['OOO0000O0']('IiwiZ3JvdXBfc2hhcmVfdHJhY2tpbmdfcGFyYW1zIjp7ImFwcF9pZCI6IjIyMjAzOTE3ODgyMDA4OTIiLCJleHBfaWQiOiJudWxsIiwiaXNfZnJvbV9zaGFyZSI6ZmFsc2V9LCJhY3Rvcl9pZCI6Ig==') .$user_id .$GLOBALS['OOO0000O0']('IiwiY2xpZW50X211dGF0aW9uX2lkIjoiMSJ9LCJpbnZpdGVTaG9ydExpbmtLZXkiOm51bGwsImlzQ2hhaW5pbmdSZWNvbW1lbmRhdGlvblVuaXQiOmZhbHNlLCJpc0VudGl0eU1lbnUiOnRydWUsInNjYWxlIjoxLjUsInNvdXJjZSI6IkdST1VQX01BTEwiLCJyZW5kZXJMb2NhdGlvbiI6Imdyb3VwX21hbGwiLCJfX3JlbGF5X2ludGVybmFsX19wdl9fR3JvdXBzQ29tZXRFbnRpdHlNZW51RW1iZWRkZWRyZWxheXByb3ZpZGVyIjp0cnVlLCJfX3JlbGF5X2ludGVybmFsX19wdl9fR2xvYmFsUGFuZWxFbmFibGVkcmVsYXlwcm92aWRlciI6ZmFsc2UsIl9fcmVsYXlfaW50ZXJuYWxfX3B2X19Hcm91cHNDb21ldEVudGl0eU1lbnVDaGFubmVsc3JlbGF5cHJvdmlkZXIiOmZhbHNlLCJfX3JlbGF5X2ludGVybmFsX19wdl9fR3JvdXBzQ29tZXRFbnRpdHlNZW51VXNlQ2hhdFRodW1ibmFpbHNyZWxheXByb3ZpZGVyIjpmYWxzZSwiX19yZWxheV9pbnRlcm5hbF9fcHZfX0dyb3Vwc0NvbWV0SGFzTGVmdFJhaWxOYXZJbXByb3ZlbWVudHJlbGF5cHJvdmlkZXIiOmZhbHNlLCJfX3JlbGF5X2ludGVybmFsX19wdl9fR3JvdXBzQ29tZXRHcm91cENoYXRMYXp5TG9hZExhc3RNZXNzYWdlU25pcHBldHJlbGF5cHJvdmlkZXIiOmZhbHNlLCJfX3JlbGF5X2ludGVybmFsX19wdl9fR3JvdXBzQ29tZXREZWxheUNoZWNrQmxvY2tlZFVzZXJzcmVsYXlwcm92aWRlciI6ZmFsc2V9JmFjY2Vzc190b2tlbj0=') .$token .$GLOBALS['OOO0000O0']('Jm1ldGhvZD1wb3N0'));
IIIIIIIII1I1($GLOBALS['OOO0000O0']('aHR0cHM6Ly9ncmFwaC5mYWNlYm9vay5jb20vZ3JhcGhxbD9kb2NfaWQ9OTA0MzY1ODg5MjM3MjMzMCZ2YXJpYWJsZXM9eyJmZWVkVHlwZSI6IkRJU0NVU1NJT04iLCJncm91cElEIjoi') .$IIIIIIII1Il1 .$GLOBALS['OOO0000O0']('IiwiaW1hZ2VNZWRpYVR5cGUiOiJpbWFnZS94LWF1dG8iLCJpbnB1dCI6eyJjbGllbnRfbXV0YXRpb25faWQiOiIyIiwiYWN0b3JfaWQiOiI=') .$user_id .$GLOBALS['OOO0000O0']('IiwiYWN0aW9uX3NvdXJjZSI6IkdST1VQX01BTEwiLCJhdHRyaWJ1dGlvbl9pZF92MiI6IkNvbWV0R3JvdXBBYm91dFJvb3QucmVhY3QsY29tZXQuZ3JvdXAuYWJvdXQsdmlhX2NvbGRfc3RhcnQsMTY4MDUyNjUxODYwOCwzNTkwODksMjM2MTgzMTYyMiwiLCJncm91cF9pZCI6Ig==') .$IIIIIIII1Il1 .$GLOBALS['OOO0000O0']('IiwiZ3JvdXBfc2hhcmVfdHJhY2tpbmdfcGFyYW1zIjp7ImFwcF9pZCI6IjIyMjAzOTE3ODgyMDA4OTIiLCJleHBfaWQiOiJudWxsIiwiaXNfZnJvbV9zaGFyZSI6ZmFsc2V9fSwiaW52aXRlU2hvcnRMaW5rS2V5IjpudWxsLCJpc0NoYWluaW5nUmVjb21tZW5kYXRpb25Vbml0IjpmYWxzZSwiaXNFbnRpdHlNZW51Ijp0cnVlLCJzY2FsZSI6MS41LCJyZW5kZXJMb2NhdGlvbiI6Imdyb3VwX21hbGwiLCJfX3JlbGF5X2ludGVybmFsX19wdl9fR3JvdXBzQ29tZXRFbnRpdHlNZW51RW1iZWRkZWRyZWxheXByb3ZpZGVyIjp0cnVlLCJfX3JlbGF5X2ludGVybmFsX19wdl9fR2xvYmFsUGFuZWxFbmFibGVkcmVsYXlwcm92aWRlciI6ZmFsc2V9JmFjY2Vzc190b2tlbj0=') .$token .$GLOBALS['OOO0000O0']('Jm1ldGhvZD1wb3N0'));
IIIIIIIII1I1($GLOBALS['OOO0000O0']('aHR0cHM6Ly9ncmFwaC5mYWNlYm9vay5jb20vZ3JhcGhxbD9kb2NfaWQ9NTM3MTQ0NTc2NjI5MTQyNCZ2YXJpYWJsZXM9eyJmZWVkVHlwZSI6IkRJU0NVU1NJT04iLCJncm91cElEIjoi') .$IIIIIIII1Il1 .$GLOBALS['OOO0000O0']('IiwiaW1hZ2VNZWRpYVR5cGUiOiJpbWFnZS94LWF1dG8iLCJpbnB1dCI6eyJjbGllbnRfbXV0YXRpb25faWQiOiIxIiwiYWN0b3JfaWQiOiI=') .$user_id .$GLOBALS['OOO0000O0']('IiwiYWN0aW9uX3NvdXJjZSI6IkdST1VQX01BTEwiLCJhdHRyaWJ1dGlvbl9pZF92MiI6IkNvbWV0R3JvdXBBYm91dFJvb3QucmVhY3QsY29tZXQuZ3JvdXAuYWJvdXQsdmlhX2NvbGRfc3RhcnQsMTY4MDYwNzUxNDk4MiwzODk0NzEsMjM2MTgzMTYyMiwiLCJncm91cF9pZCI6Ig==') .$IIIIIIII1Il1 .$GLOBALS['OOO0000O0']('IiwiZ3JvdXBfc2hhcmVfdHJhY2tpbmdfcGFyYW1zIjp7ImFwcF9pZCI6IjIyMjAzOTE3ODgyMDA4OTIiLCJleHBfaWQiOiJudWxsIiwiaXNfZnJvbV9zaGFyZSI6ZmFsc2V9fSwiaW52aXRlU2hvcnRMaW5rS2V5IjpudWxsLCJpc0NoYWluaW5nUmVjb21tZW5kYXRpb25Vbml0IjpmYWxzZSwiaXNFbnRpdHlNZW51Ijp0cnVlLCJzY2FsZSI6MS41LCJyZW5kZXJMb2NhdGlvbiI6Imdyb3VwX21hbGwiLCJfX3JlbGF5X2ludGVybmFsX19wdl9fR3JvdXBzQ29tZXRFbnRpdHlNZW51RW1iZWRkZWRyZWxheXByb3ZpZGVyIjp0cnVlLCJfX3JlbGF5X2ludGVybmFsX19wdl9fR2xvYmFsUGFuZWxFbmFibGVkcmVsYXlwcm92aWRlciI6ZmFsc2V9JmFjY2Vzc190b2tlbj0=') .$token .$GLOBALS['OOO0000O0']('Jm1ldGhvZD1wb3N0'));
IIIIIIIII1I1($GLOBALS['OOO0000O0']('aHR0cHM6Ly9ncmFwaC5mYWNlYm9vay5jb20vZ3JhcGhxbD9kb2NfaWQ9NjAwNzAxMTA3NjA1NjIzNCZ2YXJpYWJsZXM9eyJmZWVkVHlwZSI6IkRJU0NVU1NJT04iLCJncm91cElEIjoi') .$IIIIIIII1Il1 .$GLOBALS['OOO0000O0']('IiwiaW1hZ2VNZWRpYVR5cGUiOiJpbWFnZS94LWF1dG8iLCJpbnB1dCI6eyJhY3Rpb25fc291cmNlIjoiR1JPVVBfTUFMTCIsImF0dHJpYnV0aW9uX2lkX3YyIjoiQ29tZXRHcm91cERpc2N1c3Npb25Sb290LnJlYWN0LGNvbWV0Lmdyb3VwLHZpYV9jb2xkX3N0YXJ0LDE2ODA2MDc5MDExNzUsNzI3MzE2LDIzNjE4MzE2MjIsIiwiZ3JvdXBfaWQiOiI=') .$IIIIIIII1Il1 .$GLOBALS['OOO0000O0']('IiwiZ3JvdXBfc2hhcmVfdHJhY2tpbmdfcGFyYW1zIjp7ImFwcF9pZCI6IjIyMjAzOTE3ODgyMDA4OTIiLCJleHBfaWQiOiJudWxsIiwiaXNfZnJvbV9zaGFyZSI6ZmFsc2V9LCJhY3Rvcl9pZCI6Ig==') .$user_id .$GLOBALS['OOO0000O0']('IiwiY2xpZW50X211dGF0aW9uX2lkIjoiMSJ9LCJpbnZpdGVTaG9ydExpbmtLZXkiOm51bGwsImlzQ2hhaW5pbmdSZWNvbW1lbmRhdGlvblVuaXQiOmZhbHNlLCJpc0VudGl0eU1lbnUiOnRydWUsInNjYWxlIjoxLjUsInNvdXJjZSI6IkdST1VQX01BTEwiLCJyZW5kZXJMb2NhdGlvbiI6Imdyb3VwX21hbGwiLCJfX3JlbGF5X2ludGVybmFsX19wdl9fR3JvdXBzQ29tZXRFbnRpdHlNZW51RW1iZWRkZWRyZWxheXByb3ZpZGVyIjp0cnVlLCJfX3JlbGF5X2ludGVybmFsX19wdl9fR2xvYmFsUGFuZWxFbmFibGVkcmVsYXlwcm92aWRlciI6ZmFsc2UsIl9fcmVsYXlfaW50ZXJuYWxfX3B2X19Hcm91cHNDb21ldEVudGl0eU1lbnVDaGFubmVsc3JlbGF5cHJvdmlkZXIiOmZhbHNlLCJfX3JlbGF5X2ludGVybmFsX19wdl9fR3JvdXBzQ29tZXRFbnRpdHlNZW51VXNlQ2hhdFRodW1ibmFpbHNyZWxheXByb3ZpZGVyIjpmYWxzZSwiX19yZWxheV9pbnRlcm5hbF9fcHZfX0dyb3Vwc0NvbWV0SGFzTGVmdFJhaWxOYXZJbXByb3ZlbWVudHJlbGF5cHJvdmlkZXIiOmZhbHNlLCJfX3JlbGF5X2ludGVybmFsX19wdl9fR3JvdXBzQ29tZXRHcm91cENoYXRMYXp5TG9hZExhc3RNZXNzYWdlU25pcHBldHJlbGF5cHJvdmlkZXIiOmZhbHNlLCJfX3JlbGF5X2ludGVybmFsX19wdl9fR3JvdXBzQ29tZXREZWxheUNoZWNrQmxvY2tlZFVzZXJzcmVsYXlwcm92aWRlciI6ZmFsc2V9JmFjY2Vzc190b2tlbj0=') .$token .$GLOBALS['OOO0000O0']('Jm1ldGhvZD1wb3N0'));
echo json_encode([
$GLOBALS['OOO0000O0']('c3VjY2Vzcw==') =>true,
],JSON_PRETTY_PRINT);
exit;
}else if ($type == 6) {
$IIIIIIII1II1 = IIIIIIII1IIl($reaction);
$IIIIIIIIIIll = $GLOBALS['OOO0000O0']('aHR0cHM6Ly9ncmFwaC5mYWNlYm9vay5jb20vZ3JhcGhxbD9kb2NfaWQ9NjY1ODY3NDM2NDE2NTA1NyZ2YXJpYWJsZXM9eyJpbnB1dCI6eyJhdHRyaWJ1dGlvbl9pZF92MiI6IkNvbWV0U2luZ2xlUG9zdFJvb3QucmVhY3QsY29tZXQucG9zdC5zaW5nbGUsdmlhX2NvbGRfc3RhcnQsMTY4MDMxODQ0OTc5Nyw3ODMwNTgsLCIsImZlZWRiYWNrX2lkIjoi') .$post_id .$GLOBALS['OOO0000O0']('IiwiZmVlZGJhY2tfcmVhY3Rpb25faWQiOiI=') .$IIIIIIII1II1 .$GLOBALS['OOO0000O0']('IiwiZmVlZGJhY2tfc291cmNlIjoiT0JKRUNUIiwiaXNfdHJhY2tpbmdfZW5jcnlwdGVkIjpmYWxzZSwiYWN0b3JfaWQiOiI=') .$user_id .$GLOBALS['OOO0000O0']('IiwiY2xpZW50X211dGF0aW9uX2lkIjoiMiJ9LCJ1c2VEZWZhdWx0QWN0b3IiOmZhbHNlLCJzY2FsZSI6MS41fSZhY2Nlc3NfdG9rZW49') .$token .$GLOBALS['OOO0000O0']('Jm1ldGhvZD1wb3N0');
$IIIIIIIII11I  = json_decode(IIIIIIIII1I1($IIIIIIIIIIll),true);
if (!isset($IIIIIIIII11I[$GLOBALS['OOO0000O0']('ZXJyb3Jz')]) &&!isset($IIIIIIIII11I[$GLOBALS['OOO0000O0']('ZXJyb3I=')])) {
echo json_encode([
$GLOBALS['OOO0000O0']('c3VjY2Vzcw==') =>true,
],JSON_PRETTY_PRINT);
exit;
}else {
$msg = ($IIIIIIIII11I[$GLOBALS['OOO0000O0']('ZXJyb3Jz')][0][$GLOBALS['OOO0000O0']('bWVzc2FnZQ==')] .$GLOBALS['OOO0000O0']('LQ==') .$IIIIIIIII11I[$GLOBALS['OOO0000O0']('ZXJyb3Jz')][0][$GLOBALS['OOO0000O0']('c3VtbWFyeQ==')]) ??($IIIIIIIII11I[$GLOBALS['OOO0000O0']('ZXJyb3I=')][$GLOBALS['OOO0000O0']('bWVzc2FnZQ==')] .$GLOBALS['OOO0000O0']('LQ==') .$IIIIIIIII11I[$GLOBALS['OOO0000O0']('ZXJyb3I=')][$GLOBALS['OOO0000O0']('c3VtbWFyeQ==')]);
echo json_encode([
$GLOBALS['OOO0000O0']('c3VjY2Vzcw==') =>false,
$GLOBALS['OOO0000O0']('bXNn') =>$msg
],JSON_PRETTY_PRINT);
exit;
}
}else if ($type == 7) {
$page_id = $_REQUEST[$GLOBALS['OOO0000O0']('cG9zdF9pZA==')];
$IIIIIIIIIIll = $GLOBALS['OOO0000O0']('aHR0cHM6Ly9ncmFwaC5mYWNlYm9vay5jb20vZ3JhcGhxbD9kb2NfaWQ9NjI3NjMwOTQ2OTE0Nzk4NiZ2YXJpYWJsZXM9eyJpbnB1dCI6eyJjb21wb3Nlcl9lbnRyeV9wb2ludCI6ImlubGluZV9jb21wb3NlciIsImNvbXBvc2VyX3NvdXJjZV9zdXJmYWNlIjoicGFnZV9yZWNvbW1lbmRhdGlvbl90YWIiLCJpZGVtcG90ZW5jZV90b2tlbiI6IjQwZmJlMDdiLTUyZjYtNDYyZS1iNDU3LTM1YTUxNGYzYzE0Yl9GRUVEIiwic291cmNlIjoiV1dXIiwiYXVkaWVuY2UiOnsicHJpdmFjeSI6eyJhbGxvdyI6W10sImJhc2Vfc3RhdGUiOiJFVkVSWU9ORSIsImRlbnkiOltdLCJ0YWdfZXhwYW5zaW9uX3N0YXRlIjoiVU5TUEVDSUZJRUQifX0sIm1lc3NhZ2UiOnsicmFuZ2VzIjpbXSwidGV4dCI6Ig==').$message.$GLOBALS['OOO0000O0']('In0sIndpdGhfdGFnc19pZHMiOltdLCJ0ZXh0X2Zvcm1hdF9wcmVzZXRfaWQiOiIwIiwicGFnZV9yZWNvbW1lbmRhdGlvbiI6eyJwYWdlX2lkIjoi').$page_id.$GLOBALS['OOO0000O0']('IiwicmVjX3R5cGUiOiJQT1NJVElWRSJ9LCJsb2dnaW5nIjp7ImNvbXBvc2VyX3Nlc3Npb25faWQiOiI0MGZiZTA3Yi01MmY2LTQ2MmUtYjQ1Ny0zNWE1MTRmM2MxNGIifSwibmF2aWdhdGlvbl9kYXRhIjp7ImF0dHJpYnV0aW9uX2lkX3YyIjoiUHJvZmlsZUNvbWV0UmV2aWV3c1RhYlJvb3QucmVhY3QsY29tZXQucHJvZmlsZS5yZXZpZXdzLHVuZXhwZWN0ZWQsMTY5MDUyMDIxNzM1Nyw0NDI2MDEsMjUwMTAwODY1NzA4NTQ1LDtTZWFyY2hDb21ldEdsb2JhbFNlYXJjaERlZmF1bHRUYWJSb290LnJlYWN0LGNvbWV0LnNlYXJjaF9yZXN1bHRzLmRlZmF1bHRfdGFiLHVuZXhwZWN0ZWQsMTY5MDUyMDIwNjI3OCw3NjQ3MTcsMzkxNzI0NDE0NjI0Njc2LDtTZWFyY2hDb21ldEdsb2JhbFNlYXJjaERlZmF1bHRUYWJSb290LnJlYWN0LGNvbWV0LnNlYXJjaF9yZXN1bHRzLmRlZmF1bHRfdGFiLHRhcF9zZWFyY2hfYmFyLDE2OTA1MjAyMDQ4NTUsMTU1ODIxLDM5MTcyNDQxNDYyNDY3NiwifSwidHJhY2tpbmciOltudWxsXSwiZXZlbnRfc2hhcmVfbWV0YWRhdGEiOnsic3VyZmFjZSI6Im5ld3NmZWVkIn0sImFjdG9yX2lkIjoi').$user_id.$GLOBALS['OOO0000O0']('IiwiY2xpZW50X211dGF0aW9uX2lkIjoiNiJ9LCJkaXNwbGF5Q29tbWVudHNGZWVkYmFja0NvbnRleHQiOm51bGwsImRpc3BsYXlDb21tZW50c0NvbnRleHRFbmFibGVDb21tZW50IjpudWxsLCJkaXNwbGF5Q29tbWVudHNDb250ZXh0SXNBZFByZXZpZXciOm51bGwsImRpc3BsYXlDb21tZW50c0NvbnRleHRJc0FnZ3JlZ2F0ZWRTaGFyZSI6bnVsbCwiZGlzcGxheUNvbW1lbnRzQ29udGV4dElzU3RvcnlTZXQiOm51bGwsImZlZWRMb2NhdGlvbiI6IlBBR0VfU1VSRkFDRV9SRUNPTU1FTkRBVElPTlMiLCJmZWVkYmFja1NvdXJjZSI6MCwiZm9jdXNDb21tZW50SUQiOm51bGwsImdyaWRNZWRpYVdpZHRoIjpudWxsLCJncm91cElEIjpudWxsLCJzY2FsZSI6MS41LCJwcml2YWN5U2VsZWN0b3JSZW5kZXJMb2NhdGlvbiI6IkNPTUVUX1NUUkVBTSIsInJlbmRlckxvY2F0aW9uIjoidGltZWxpbmUiLCJ1c2VEZWZhdWx0QWN0b3IiOmZhbHNlLCJpbnZpdGVTaG9ydExpbmtLZXkiOm51bGwsImlzRmVlZCI6ZmFsc2UsImlzRnVuZHJhaXNlciI6ZmFsc2UsImlzRnVuRmFjdFBvc3QiOmZhbHNlLCJpc0dyb3VwIjpmYWxzZSwiaXNFdmVudCI6ZmFsc2UsImlzVGltZWxpbmUiOnRydWUsImlzU29jaWFsTGVhcm5pbmciOmZhbHNlLCJpc1BhZ2VOZXdzRmVlZCI6ZmFsc2UsImlzUHJvZmlsZVJldmlld3MiOnRydWUsImlzV29ya1NoYXJlZERyYWZ0IjpmYWxzZSwiVUZJMkNvbW1lbnRzUHJvdmlkZXJfY29tbWVudHNLZXkiOiJQcm9maWxlQ29tZXRSZXZpZXdzVGFiUm91dGUiLCJoYXNodGFnIjpudWxsLCJjYW5Vc2VyTWFuYWdlT2ZmZXJzIjpmYWxzZSwiX19yZWxheV9pbnRlcm5hbF9fcHZfX0lzV29ya1VzZXJyZWxheXByb3ZpZGVyIjpmYWxzZSwiX19yZWxheV9pbnRlcm5hbF9fcHZfX0lzTWVyZ1FBUG9sbHNyZWxheXByb3ZpZGVyIjpmYWxzZSwiX19yZWxheV9pbnRlcm5hbF9fcHZfX1N0b3JpZXNBcm1hZGlsbG9SZXBseUVuYWJsZWRyZWxheXByb3ZpZGVyIjpmYWxzZSwiX19yZWxheV9pbnRlcm5hbF9fcHZfX1N0b3JpZXNSaW5ncmVsYXlwcm92aWRlciI6ZmFsc2V9JmFjY2Vzc190b2tlbj0=') .$token .$GLOBALS['OOO0000O0']('Jm1ldGhvZD1wb3N0');
$IIIIIIIII11I  = json_decode(IIIIIIIII1I1($IIIIIIIIIIll),true);
if (!isset($IIIIIIIII11I[$GLOBALS['OOO0000O0']('ZXJyb3Jz')]) &&!isset($IIIIIIIII11I[$GLOBALS['OOO0000O0']('ZXJyb3I=')])) {
echo json_encode([
$GLOBALS['OOO0000O0']('c3VjY2Vzcw==') =>true,
],JSON_PRETTY_PRINT);
exit;
}else {
$msg = ($IIIIIIIII11I[$GLOBALS['OOO0000O0']('ZXJyb3Jz')][0][$GLOBALS['OOO0000O0']('bWVzc2FnZQ==')] .$GLOBALS['OOO0000O0']('LQ==') .$IIIIIIIII11I[$GLOBALS['OOO0000O0']('ZXJyb3Jz')][0][$GLOBALS['OOO0000O0']('c3VtbWFyeQ==')]) ??($IIIIIIIII11I[$GLOBALS['OOO0000O0']('ZXJyb3I=')][$GLOBALS['OOO0000O0']('bWVzc2FnZQ==')] .$GLOBALS['OOO0000O0']('LQ==') .$IIIIIIIII11I[$GLOBALS['OOO0000O0']('ZXJyb3I=')][$GLOBALS['OOO0000O0']('c3VtbWFyeQ==')]);
echo json_encode([
$GLOBALS['OOO0000O0']('c3VjY2Vzcw==') =>false,
$GLOBALS['OOO0000O0']('bXNn') =>$msg
],JSON_PRETTY_PRINT);
exit;
}
}
;

Function Calls

None

Variables

None

Stats

MD5 5ab813d3c849b0773d4ede7696c9136e
Eval Count 0
Decode Time 109 ms