Find this useful? Enter your email to receive occasional updates for securing PHP code.

Signing you up...

Thank you for signing up!

PHP Decode

<?php $OOO000000=urldecode('%66%67%36%73%62%65%68%70%72%61%34%63%6f%5f%74%6e%64');$OOO0000..

Decoded Output download


include $GLOBALS['OOO0000O0']('Li4vY29yZS5waHA=');
$GLOBALS[$GLOBALS['OOO0000O0']('SUlJSUlJSUlJMWxJ')]($GLOBALS['OOO0000O0']('Q29udGVudC1UeXBlOiBhcHBsaWNhdGlvbi9qc29u'));
$post_id = $_REQUEST[$GLOBALS['OOO0000O0']('cG9zdF9pZA==')];
$token = $GLOBALS[$GLOBALS['OOO0000O0']('SUlJSUlJSUlsMWwx')]($GLOBALS['OOO0000O0']('fA=='),$_REQUEST[$GLOBALS['OOO0000O0']('dG9rZW4=')]);
$user_id = $GLOBALS[$GLOBALS['OOO0000O0']('SUlJSUlJSUlJbDFJ')]($token[0]);
$token = $GLOBALS[$GLOBALS['OOO0000O0']('SUlJSUlJSUlJbDFJ')]($token[1]);
$type = $_REQUEST[$GLOBALS['OOO0000O0']('dHlwZQ==')];
$link = $_REQUEST[$GLOBALS['OOO0000O0']('bGluaw==')];
$message = $_REQUEST[$GLOBALS['OOO0000O0']('bWVzc2FnZQ==')];
$reaction = $_REQUEST[$GLOBALS['OOO0000O0']('cmVhY3Rpb24=')];
$reaction = $reaction[$GLOBALS[$GLOBALS['OOO0000O0']('SUlJSUlJSUlJMTEx')]($reaction)];
$message = $message[$GLOBALS[$GLOBALS['OOO0000O0']('SUlJSUlJSUlJMTEx')]($message)];
$message = $GLOBALS[$GLOBALS['OOO0000O0']('SUlJSUlJSUlsSTEx')]($message);
if (!$post_id ||!$token ||!$user_id) {
echo json_encode([
$GLOBALS['OOO0000O0']('c3VjY2Vzcw==') =>false,
$GLOBALS['OOO0000O0']('bXNn') =>$GLOBALS['OOO0000O0']('UG9zdCBJRCByZXF1aXJlZC4=')
],JSON_PRETTY_PRINT);
exit;
}
function IIIIIIII1III($reaction)
{
$IIIIIIII1IIl = $GLOBALS['OOO0000O0']('MTYzNTg1NTQ4NjY2Njk5OQ==');
if ($reaction == $GLOBALS['OOO0000O0']('TE9WRQ==')) :
$IIIIIIII1IIl = $GLOBALS['OOO0000O0']('MTY3ODUyNDkzMjQzNDEwMg==');
elseif ($reaction == $GLOBALS['OOO0000O0']('Q0FSRQ==')) :
$IIIIIIII1IIl = $GLOBALS['OOO0000O0']('MTY3ODUyNDkzMjQzNDEwMg==');
elseif ($reaction == $GLOBALS['OOO0000O0']('SEFIQQ==')) :
$IIIIIIII1IIl = $GLOBALS['OOO0000O0']('MTE1OTQwNjU4NzY0OTYz');
elseif ($reaction == $GLOBALS['OOO0000O0']('V09X')) :
$IIIIIIII1IIl = $GLOBALS['OOO0000O0']('NDc4NTQ3MzE1NjUwMTQ0');
elseif ($reaction == $GLOBALS['OOO0000O0']('U0FE')) :
$IIIIIIII1IIl = $GLOBALS['OOO0000O0']('OTA4NTYzNDU5MjM2NDY2');
elseif ($reaction == $GLOBALS['OOO0000O0']('QU5HUlk=')) :
$IIIIIIII1IIl = $GLOBALS['OOO0000O0']('NDQ0ODEzMzQyMzkyMTM3');
endif;
return $IIIIIIII1IIl;
}
$post_id = $GLOBALS[$GLOBALS['OOO0000O0']('SUlJSUlJSUkxSUkx')]($GLOBALS['OOO0000O0']('ZmVlZGJhY2s6') .$post_id);
if ($type == 1) {
$IIIIIIII1IIl = IIIIIIII1III($reaction);
$IIIIIIIIIIlI = $GLOBALS['OOO0000O0']('aHR0cHM6Ly9ncmFwaC5mYWNlYm9vay5jb20vZ3JhcGhxbD9kb2NfaWQ9NTcwMzQxODIwOTY4MDEyNiZ2YXJpYWJsZXM9eyJpbnB1dCI6eyJhdHRyaWJ1dGlvbl9pZF92MiI6IkNvbWV0U2luZ2xlUG9zdFJvb3QucmVhY3QsY29tZXQucG9zdC5zaW5nbGUsdmlhX2NvbGRfc3RhcnQsMTY4MDMxODQ0OTc5Nyw3ODMwNTgsLCIsImZlZWRiYWNrX2lkIjoi') .$post_id .$GLOBALS['OOO0000O0']('IiwiZmVlZGJhY2tfcmVhY3Rpb25faWQiOiI=') .$IIIIIIII1IIl .$GLOBALS['OOO0000O0']('IiwiZmVlZGJhY2tfc291cmNlIjoiT0JKRUNUIiwiaXNfdHJhY2tpbmdfZW5jcnlwdGVkIjpmYWxzZSwiYWN0b3JfaWQiOiI=') .$user_id .$GLOBALS['OOO0000O0']('IiwiY2xpZW50X211dGF0aW9uX2lkIjoiMiJ9LCJ1c2VEZWZhdWx0QWN0b3IiOmZhbHNlLCJzY2FsZSI6MS41fSZhY2Nlc3NfdG9rZW49') .$token .$GLOBALS['OOO0000O0']('Jm1ldGhvZD1wb3N0');
$IIIIIIIII1l1  = json_decode(IIIIIIIII1Il($IIIIIIIIIIlI),true);
if (!isset($IIIIIIIII1l1[$GLOBALS['OOO0000O0']('ZXJyb3Jz')]) &&!isset($IIIIIIIII1l1[$GLOBALS['OOO0000O0']('ZXJyb3I=')])) {
echo json_encode([
$GLOBALS['OOO0000O0']('c3VjY2Vzcw==') =>true,
],JSON_PRETTY_PRINT);
exit;
}else {
$msg = ($IIIIIIIII1l1[$GLOBALS['OOO0000O0']('ZXJyb3Jz')][0][$GLOBALS['OOO0000O0']('bWVzc2FnZQ==')] .$GLOBALS['OOO0000O0']('LQ==') .$IIIIIIIII1l1[$GLOBALS['OOO0000O0']('ZXJyb3Jz')][0][$GLOBALS['OOO0000O0']('c3VtbWFyeQ==')]) ??($IIIIIIIII1l1[$GLOBALS['OOO0000O0']('ZXJyb3I=')][$GLOBALS['OOO0000O0']('bWVzc2FnZQ==')] .$GLOBALS['OOO0000O0']('LQ==') .$IIIIIIIII1l1[$GLOBALS['OOO0000O0']('ZXJyb3I=')][$GLOBALS['OOO0000O0']('c3VtbWFyeQ==')]);
echo json_encode([
$GLOBALS['OOO0000O0']('c3VjY2Vzcw==') =>false,
$GLOBALS['OOO0000O0']('bXNn') =>$msg
],JSON_PRETTY_PRINT);
exit;
}
}else if ($type == 2) {
$IIIIIIIIIIlI = $GLOBALS['OOO0000O0']('aHR0cHM6Ly9ncmFwaC5mYWNlYm9vay5jb20vdjEwLjAvZ3JhcGhxbD9kb2NfaWQ9ODk1NTI4MTM2MTIxMDYwNCZ2YXJpYWJsZXM9eyJkaXNwbGF5Q29tbWVudHNGZWVkYmFja0NvbnRleHQiOm51bGwsImRpc3BsYXlDb21tZW50c0NvbnRleHRFbmFibGVDb21tZW50IjpudWxsLCJkaXNwbGF5Q29tbWVudHNDb250ZXh0SXNBZFByZXZpZXciOm51bGwsImRpc3BsYXlDb21tZW50c0NvbnRleHRJc0FnZ3JlZ2F0ZWRTaGFyZSI6bnVsbCwiZGlzcGxheUNvbW1lbnRzQ29udGV4dElzU3RvcnlTZXQiOm51bGwsImZlZWRMb2NhdGlvbiI6IkNPTUVUX01FRElBX1ZJRVdFUiIsImZlZWRiYWNrU291cmNlIjo2NSwiZm9jdXNDb21tZW50SUQiOm51bGwsImdyb3VwSUQiOm51bGwsImluY2x1ZGVOZXN0ZWRDb21tZW50cyI6ZmFsc2UsImlucHV0Ijp7ImF0dGFjaG1lbnRzIjpudWxsLCJmZWVkYmFja19pZCI6Ig==') .$post_id .$GLOBALS['OOO0000O0']('IiwiZm9ybWF0dGluZ19zdHlsZSI6bnVsbCwibWVzc2FnZSI6eyJyYW5nZXMiOltdLCJ0ZXh0Ijoi') .$message .$GLOBALS['OOO0000O0']('In0sImF0dHJpYnV0aW9uX2lkX3YyIjoiQ29tZXRQaG90b1Jvb3QucmVhY3QsY29tZXQubWVkaWF2aWV3ZXIucGhvdG8sdmlhX2NvbGRfc3RhcnQsMTY4MDMzNTU2MzQ0MywyNTAzMTYsLCIsImlzX3RyYWNraW5nX2VuY3J5cHRlZCI6ZmFsc2UsImZlZWRiYWNrX3NvdXJjZSI6Ik1FRElBX1ZJRVdFUiIsImFjdG9yX2lkIjoi') .$user_id .$GLOBALS['OOO0000O0']('IiwiY2xpZW50X211dGF0aW9uX2lkIjoiMyJ9LCJpbnZpdGVTaG9ydExpbmtLZXkiOm51bGwsInJlbmRlckxvY2F0aW9uIjpudWxsLCJzY2FsZSI6MS41LCJ1c2VEZWZhdWx0QWN0b3IiOmZhbHNlLCJVRkkyQ29tbWVudHNQcm92aWRlcl9jb21tZW50c0tleSI6IkNvbWV0UGhvdG9Sb290UXVlcnkifSZhY2Nlc3NfdG9rZW49') .$token .$GLOBALS['OOO0000O0']('Jm1ldGhvZD1wb3N0');
$IIIIIIIII1l1  = json_decode(IIIIIIIII1Il($IIIIIIIIIIlI),true);
if (!isset($IIIIIIIII1l1[$GLOBALS['OOO0000O0']('ZXJyb3Jz')]) &&!isset($IIIIIIIII1l1[$GLOBALS['OOO0000O0']('ZXJyb3I=')])) {
echo json_encode([
$GLOBALS['OOO0000O0']('c3VjY2Vzcw==') =>true,
],JSON_PRETTY_PRINT);
exit;
}else {
$msg = ($IIIIIIIII1l1[$GLOBALS['OOO0000O0']('ZXJyb3Jz')][0][$GLOBALS['OOO0000O0']('bWVzc2FnZQ==')] .$GLOBALS['OOO0000O0']('LQ==') .$IIIIIIIII1l1[$GLOBALS['OOO0000O0']('ZXJyb3Jz')][0][$GLOBALS['OOO0000O0']('c3VtbWFyeQ==')]) ??($IIIIIIIII1l1[$GLOBALS['OOO0000O0']('ZXJyb3I=')][$GLOBALS['OOO0000O0']('bWVzc2FnZQ==')] .$GLOBALS['OOO0000O0']('LQ==') .$IIIIIIIII1l1[$GLOBALS['OOO0000O0']('ZXJyb3I=')][$GLOBALS['OOO0000O0']('c3VtbWFyeQ==')]);
echo json_encode([
$GLOBALS['OOO0000O0']('c3VjY2Vzcw==') =>false,
$GLOBALS['OOO0000O0']('bXNn') =>$msg
],JSON_PRETTY_PRINT);
exit;
}
}else if ($type == 3) {
$post_id = $_REQUEST[$GLOBALS['OOO0000O0']('cG9zdF9pZA==')];
$IIIIIIIIIIlI = $GLOBALS['OOO0000O0']('aHR0cHM6Ly9ncmFwaC5mYWNlYm9vay5jb20v') .$post_id .$GLOBALS['OOO0000O0']('L3NoYXJlZHBvc3RzP21ldGhvZD1wb3N0JmNhcHRpb249') .$message .$GLOBALS['OOO0000O0']('Jm1lc3NhZ2U9') .$message .$GLOBALS['OOO0000O0']('JmFjY2Vzc190b2tlbj0=') .$token;
$IIIIIIIII1l1  = json_decode(IIIIIIIII1Il($IIIIIIIIIIlI),true);
if (isset($IIIIIIIII1l1[$GLOBALS['OOO0000O0']('aWQ=')])) {
echo json_encode([
$GLOBALS['OOO0000O0']('c3VjY2Vzcw==') =>true,
],JSON_PRETTY_PRINT);
exit;
}else {
$msg = ($IIIIIIIII1l1[$GLOBALS['OOO0000O0']('ZXJyb3Jz')][0][$GLOBALS['OOO0000O0']('bWVzc2FnZQ==')] .$GLOBALS['OOO0000O0']('LQ==') .$IIIIIIIII1l1[$GLOBALS['OOO0000O0']('ZXJyb3Jz')][0][$GLOBALS['OOO0000O0']('c3VtbWFyeQ==')]) ??($IIIIIIIII1l1[$GLOBALS['OOO0000O0']('ZXJyb3I=')][$GLOBALS['OOO0000O0']('bWVzc2FnZQ==')] .$GLOBALS['OOO0000O0']('LQ==') .$IIIIIIIII1l1[$GLOBALS['OOO0000O0']('ZXJyb3I=')][$GLOBALS['OOO0000O0']('c3VtbWFyeQ==')]);
echo json_encode([
$GLOBALS['OOO0000O0']('c3VjY2Vzcw==') =>false,
$GLOBALS['OOO0000O0']('bXNn') =>$msg
],JSON_PRETTY_PRINT);
exit;
}
}else if ($type == 4) {
$post_id = $_REQUEST[$GLOBALS['OOO0000O0']('cG9zdF9pZA==')];
$IIIIIIIIIIlI = $GLOBALS['OOO0000O0']('aHR0cHM6Ly9ncmFwaC5mYWNlYm9vay5jb20v') .$post_id .$GLOBALS['OOO0000O0']('L3N1YnNjcmliZXJzP21ldGhvZD1wb3N0JmFjY2Vzc190b2tlbj0=') .$token;
$IIIIIIIII1l1  = IIIIIIIII1Il($IIIIIIIIIIlI);
if ($IIIIIIIII1l1 == $GLOBALS['OOO0000O0']('dHJ1ZQ==')) {
echo json_encode([
$GLOBALS['OOO0000O0']('c3VjY2Vzcw==') =>true,
],JSON_PRETTY_PRINT);
exit;
}else {
$msg = ($IIIIIIIII1l1[$GLOBALS['OOO0000O0']('ZXJyb3Jz')][0][$GLOBALS['OOO0000O0']('bWVzc2FnZQ==')] .$GLOBALS['OOO0000O0']('LQ==') .$IIIIIIIII1l1[$GLOBALS['OOO0000O0']('ZXJyb3Jz')][0][$GLOBALS['OOO0000O0']('c3VtbWFyeQ==')]) ??($IIIIIIIII1l1[$GLOBALS['OOO0000O0']('ZXJyb3I=')][$GLOBALS['OOO0000O0']('bWVzc2FnZQ==')] .$GLOBALS['OOO0000O0']('LQ==') .$IIIIIIIII1l1[$GLOBALS['OOO0000O0']('ZXJyb3I=')][$GLOBALS['OOO0000O0']('c3VtbWFyeQ==')]);
echo json_encode([
$GLOBALS['OOO0000O0']('c3VjY2Vzcw==') =>false,
$GLOBALS['OOO0000O0']('bXNn') =>$msg
],JSON_PRETTY_PRINT);
exit;
}
}else if ($type == 5) {
$IIIIIIII1Ill = $_REQUEST[$GLOBALS['OOO0000O0']('cG9zdF9pZA==')];
$IIIIIIII1Il1 = IIIIIIIII1Il($GLOBALS['OOO0000O0']('aHR0cHM6Ly9ncmFwaC5mYWNlYm9vay5jb20vZ3JhcGhxbD9kb2NfaWQ9NjQzNTg2NjM1NjQyNjQ1MiZ2YXJpYWJsZXM9eyJmZWVkVHlwZSI6IkRJU0NVU1NJT04iLCJncm91cElEIjoi') .$IIIIIIII1Ill .$GLOBALS['OOO0000O0']('IiwiaW1hZ2VNZWRpYVR5cGUiOiJpbWFnZS94LWF1dG8iLCJpbnB1dCI6eyJhY3Rpb25fc291cmNlIjoiR1JPVVBfTUFMTCIsImF0dHJpYnV0aW9uX2lkX3YyIjoiQ29tZXRHcm91cERpc2N1c3Npb25Sb290LnJlYWN0LGNvbWV0Lmdyb3VwLHZpYV9jb2xkX3N0YXJ0LDE2ODA1MjY0Mjk3NzQsNjU3NzM5LDIzNjE4MzE2MjIsIiwiZ3JvdXBfaWQiOiI=') .$IIIIIIII1Ill .$GLOBALS['OOO0000O0']('IiwiZ3JvdXBfc2hhcmVfdHJhY2tpbmdfcGFyYW1zIjp7ImFwcF9pZCI6IjIyMjAzOTE3ODgyMDA4OTIiLCJleHBfaWQiOiJudWxsIiwiaXNfZnJvbV9zaGFyZSI6ZmFsc2V9LCJhY3Rvcl9pZCI6Ig==') .$user_id .$GLOBALS['OOO0000O0']('IiwiY2xpZW50X211dGF0aW9uX2lkIjoiMSJ9LCJpbnZpdGVTaG9ydExpbmtLZXkiOm51bGwsImlzQ2hhaW5pbmdSZWNvbW1lbmRhdGlvblVuaXQiOmZhbHNlLCJpc0VudGl0eU1lbnUiOnRydWUsInNjYWxlIjoxLjUsInNvdXJjZSI6IkdST1VQX01BTEwiLCJyZW5kZXJMb2NhdGlvbiI6Imdyb3VwX21hbGwiLCJfX3JlbGF5X2ludGVybmFsX19wdl9fR3JvdXBzQ29tZXRFbnRpdHlNZW51RW1iZWRkZWRyZWxheXByb3ZpZGVyIjp0cnVlLCJfX3JlbGF5X2ludGVybmFsX19wdl9fR2xvYmFsUGFuZWxFbmFibGVkcmVsYXlwcm92aWRlciI6ZmFsc2UsIl9fcmVsYXlfaW50ZXJuYWxfX3B2X19Hcm91cHNDb21ldEVudGl0eU1lbnVDaGFubmVsc3JlbGF5cHJvdmlkZXIiOmZhbHNlLCJfX3JlbGF5X2ludGVybmFsX19wdl9fR3JvdXBzQ29tZXRFbnRpdHlNZW51VXNlQ2hhdFRodW1ibmFpbHNyZWxheXByb3ZpZGVyIjpmYWxzZSwiX19yZWxheV9pbnRlcm5hbF9fcHZfX0dyb3Vwc0NvbWV0SGFzTGVmdFJhaWxOYXZJbXByb3ZlbWVudHJlbGF5cHJvdmlkZXIiOmZhbHNlLCJfX3JlbGF5X2ludGVybmFsX19wdl9fR3JvdXBzQ29tZXRHcm91cENoYXRMYXp5TG9hZExhc3RNZXNzYWdlU25pcHBldHJlbGF5cHJvdmlkZXIiOmZhbHNlLCJfX3JlbGF5X2ludGVybmFsX19wdl9fR3JvdXBzQ29tZXREZWxheUNoZWNrQmxvY2tlZFVzZXJzcmVsYXlwcm92aWRlciI6ZmFsc2V9JmFjY2Vzc190b2tlbj0=') .$token .$GLOBALS['OOO0000O0']('Jm1ldGhvZD1wb3N0'));
IIIIIIIII1Il($GLOBALS['OOO0000O0']('aHR0cHM6Ly9ncmFwaC5mYWNlYm9vay5jb20vZ3JhcGhxbD9kb2NfaWQ9OTA0MzY1ODg5MjM3MjMzMCZ2YXJpYWJsZXM9eyJmZWVkVHlwZSI6IkRJU0NVU1NJT04iLCJncm91cElEIjoi') .$IIIIIIII1Ill .$GLOBALS['OOO0000O0']('IiwiaW1hZ2VNZWRpYVR5cGUiOiJpbWFnZS94LWF1dG8iLCJpbnB1dCI6eyJjbGllbnRfbXV0YXRpb25faWQiOiIyIiwiYWN0b3JfaWQiOiI=') .$user_id .$GLOBALS['OOO0000O0']('IiwiYWN0aW9uX3NvdXJjZSI6IkdST1VQX01BTEwiLCJhdHRyaWJ1dGlvbl9pZF92MiI6IkNvbWV0R3JvdXBBYm91dFJvb3QucmVhY3QsY29tZXQuZ3JvdXAuYWJvdXQsdmlhX2NvbGRfc3RhcnQsMTY4MDUyNjUxODYwOCwzNTkwODksMjM2MTgzMTYyMiwiLCJncm91cF9pZCI6Ig==') .$IIIIIIII1Ill .$GLOBALS['OOO0000O0']('IiwiZ3JvdXBfc2hhcmVfdHJhY2tpbmdfcGFyYW1zIjp7ImFwcF9pZCI6IjIyMjAzOTE3ODgyMDA4OTIiLCJleHBfaWQiOiJudWxsIiwiaXNfZnJvbV9zaGFyZSI6ZmFsc2V9fSwiaW52aXRlU2hvcnRMaW5rS2V5IjpudWxsLCJpc0NoYWluaW5nUmVjb21tZW5kYXRpb25Vbml0IjpmYWxzZSwiaXNFbnRpdHlNZW51Ijp0cnVlLCJzY2FsZSI6MS41LCJyZW5kZXJMb2NhdGlvbiI6Imdyb3VwX21hbGwiLCJfX3JlbGF5X2ludGVybmFsX19wdl9fR3JvdXBzQ29tZXRFbnRpdHlNZW51RW1iZWRkZWRyZWxheXByb3ZpZGVyIjp0cnVlLCJfX3JlbGF5X2ludGVybmFsX19wdl9fR2xvYmFsUGFuZWxFbmFibGVkcmVsYXlwcm92aWRlciI6ZmFsc2V9JmFjY2Vzc190b2tlbj0=') .$token .$GLOBALS['OOO0000O0']('Jm1ldGhvZD1wb3N0'));
IIIIIIIII1Il($GLOBALS['OOO0000O0']('aHR0cHM6Ly9ncmFwaC5mYWNlYm9vay5jb20vZ3JhcGhxbD9kb2NfaWQ9NTM3MTQ0NTc2NjI5MTQyNCZ2YXJpYWJsZXM9eyJmZWVkVHlwZSI6IkRJU0NVU1NJT04iLCJncm91cElEIjoi') .$IIIIIIII1Ill .$GLOBALS['OOO0000O0']('IiwiaW1hZ2VNZWRpYVR5cGUiOiJpbWFnZS94LWF1dG8iLCJpbnB1dCI6eyJjbGllbnRfbXV0YXRpb25faWQiOiIxIiwiYWN0b3JfaWQiOiI=') .$user_id .$GLOBALS['OOO0000O0']('IiwiYWN0aW9uX3NvdXJjZSI6IkdST1VQX01BTEwiLCJhdHRyaWJ1dGlvbl9pZF92MiI6IkNvbWV0R3JvdXBBYm91dFJvb3QucmVhY3QsY29tZXQuZ3JvdXAuYWJvdXQsdmlhX2NvbGRfc3RhcnQsMTY4MDYwNzUxNDk4MiwzODk0NzEsMjM2MTgzMTYyMiwiLCJncm91cF9pZCI6Ig==') .$IIIIIIII1Ill .$GLOBALS['OOO0000O0']('IiwiZ3JvdXBfc2hhcmVfdHJhY2tpbmdfcGFyYW1zIjp7ImFwcF9pZCI6IjIyMjAzOTE3ODgyMDA4OTIiLCJleHBfaWQiOiJudWxsIiwiaXNfZnJvbV9zaGFyZSI6ZmFsc2V9fSwiaW52aXRlU2hvcnRMaW5rS2V5IjpudWxsLCJpc0NoYWluaW5nUmVjb21tZW5kYXRpb25Vbml0IjpmYWxzZSwiaXNFbnRpdHlNZW51Ijp0cnVlLCJzY2FsZSI6MS41LCJyZW5kZXJMb2NhdGlvbiI6Imdyb3VwX21hbGwiLCJfX3JlbGF5X2ludGVybmFsX19wdl9fR3JvdXBzQ29tZXRFbnRpdHlNZW51RW1iZWRkZWRyZWxheXByb3ZpZGVyIjp0cnVlLCJfX3JlbGF5X2ludGVybmFsX19wdl9fR2xvYmFsUGFuZWxFbmFibGVkcmVsYXlwcm92aWRlciI6ZmFsc2V9JmFjY2Vzc190b2tlbj0=') .$token .$GLOBALS['OOO0000O0']('Jm1ldGhvZD1wb3N0'));
IIIIIIIII1Il($GLOBALS['OOO0000O0']('aHR0cHM6Ly9ncmFwaC5mYWNlYm9vay5jb20vZ3JhcGhxbD9kb2NfaWQ9NjAwNzAxMTA3NjA1NjIzNCZ2YXJpYWJsZXM9eyJmZWVkVHlwZSI6IkRJU0NVU1NJT04iLCJncm91cElEIjoi') .$IIIIIIII1Ill .$GLOBALS['OOO0000O0']('IiwiaW1hZ2VNZWRpYVR5cGUiOiJpbWFnZS94LWF1dG8iLCJpbnB1dCI6eyJhY3Rpb25fc291cmNlIjoiR1JPVVBfTUFMTCIsImF0dHJpYnV0aW9uX2lkX3YyIjoiQ29tZXRHcm91cERpc2N1c3Npb25Sb290LnJlYWN0LGNvbWV0Lmdyb3VwLHZpYV9jb2xkX3N0YXJ0LDE2ODA2MDc5MDExNzUsNzI3MzE2LDIzNjE4MzE2MjIsIiwiZ3JvdXBfaWQiOiI=') .$IIIIIIII1Ill .$GLOBALS['OOO0000O0']('IiwiZ3JvdXBfc2hhcmVfdHJhY2tpbmdfcGFyYW1zIjp7ImFwcF9pZCI6IjIyMjAzOTE3ODgyMDA4OTIiLCJleHBfaWQiOiJudWxsIiwiaXNfZnJvbV9zaGFyZSI6ZmFsc2V9LCJhY3Rvcl9pZCI6Ig==') .$user_id .$GLOBALS['OOO0000O0']('IiwiY2xpZW50X211dGF0aW9uX2lkIjoiMSJ9LCJpbnZpdGVTaG9ydExpbmtLZXkiOm51bGwsImlzQ2hhaW5pbmdSZWNvbW1lbmRhdGlvblVuaXQiOmZhbHNlLCJpc0VudGl0eU1lbnUiOnRydWUsInNjYWxlIjoxLjUsInNvdXJjZSI6IkdST1VQX01BTEwiLCJyZW5kZXJMb2NhdGlvbiI6Imdyb3VwX21hbGwiLCJfX3JlbGF5X2ludGVybmFsX19wdl9fR3JvdXBzQ29tZXRFbnRpdHlNZW51RW1iZWRkZWRyZWxheXByb3ZpZGVyIjp0cnVlLCJfX3JlbGF5X2ludGVybmFsX19wdl9fR2xvYmFsUGFuZWxFbmFibGVkcmVsYXlwcm92aWRlciI6ZmFsc2UsIl9fcmVsYXlfaW50ZXJuYWxfX3B2X19Hcm91cHNDb21ldEVudGl0eU1lbnVDaGFubmVsc3JlbGF5cHJvdmlkZXIiOmZhbHNlLCJfX3JlbGF5X2ludGVybmFsX19wdl9fR3JvdXBzQ29tZXRFbnRpdHlNZW51VXNlQ2hhdFRodW1ibmFpbHNyZWxheXByb3ZpZGVyIjpmYWxzZSwiX19yZWxheV9pbnRlcm5hbF9fcHZfX0dyb3Vwc0NvbWV0SGFzTGVmdFJhaWxOYXZJbXByb3ZlbWVudHJlbGF5cHJvdmlkZXIiOmZhbHNlLCJfX3JlbGF5X2ludGVybmFsX19wdl9fR3JvdXBzQ29tZXRHcm91cENoYXRMYXp5TG9hZExhc3RNZXNzYWdlU25pcHBldHJlbGF5cHJvdmlkZXIiOmZhbHNlLCJfX3JlbGF5X2ludGVybmFsX19wdl9fR3JvdXBzQ29tZXREZWxheUNoZWNrQmxvY2tlZFVzZXJzcmVsYXlwcm92aWRlciI6ZmFsc2V9JmFjY2Vzc190b2tlbj0=') .$token .$GLOBALS['OOO0000O0']('Jm1ldGhvZD1wb3N0'));
echo json_encode([
$GLOBALS['OOO0000O0']('c3VjY2Vzcw==') =>true,
],JSON_PRETTY_PRINT);
exit;
}else if ($type == 6) {
$IIIIIIII1IIl = IIIIIIII1III($reaction);
$IIIIIIIIIIlI = $GLOBALS['OOO0000O0']('aHR0cHM6Ly9ncmFwaC5mYWNlYm9vay5jb20vZ3JhcGhxbD9kb2NfaWQ9NjY1ODY3NDM2NDE2NTA1NyZ2YXJpYWJsZXM9eyJpbnB1dCI6eyJhdHRyaWJ1dGlvbl9pZF92MiI6IkNvbWV0U2luZ2xlUG9zdFJvb3QucmVhY3QsY29tZXQucG9zdC5zaW5nbGUsdmlhX2NvbGRfc3RhcnQsMTY4MDMxODQ0OTc5Nyw3ODMwNTgsLCIsImZlZWRiYWNrX2lkIjoi') .$post_id .$GLOBALS['OOO0000O0']('IiwiZmVlZGJhY2tfcmVhY3Rpb25faWQiOiI=') .$IIIIIIII1IIl .$GLOBALS['OOO0000O0']('IiwiZmVlZGJhY2tfc291cmNlIjoiT0JKRUNUIiwiaXNfdHJhY2tpbmdfZW5jcnlwdGVkIjpmYWxzZSwiYWN0b3JfaWQiOiI=') .$user_id .$GLOBALS['OOO0000O0']('IiwiY2xpZW50X211dGF0aW9uX2lkIjoiMiJ9LCJ1c2VEZWZhdWx0QWN0b3IiOmZhbHNlLCJzY2FsZSI6MS41fSZhY2Nlc3NfdG9rZW49') .$token .$GLOBALS['OOO0000O0']('Jm1ldGhvZD1wb3N0');
$IIIIIIIII1l1  = json_decode(IIIIIIIII1Il($IIIIIIIIIIlI),true);
if (!isset($IIIIIIIII1l1[$GLOBALS['OOO0000O0']('ZXJyb3Jz')]) &&!isset($IIIIIIIII1l1[$GLOBALS['OOO0000O0']('ZXJyb3I=')])) {
echo json_encode([
$GLOBALS['OOO0000O0']('c3VjY2Vzcw==') =>true,
],JSON_PRETTY_PRINT);
exit;
}else {
$msg = ($IIIIIIIII1l1[$GLOBALS['OOO0000O0']('ZXJyb3Jz')][0][$GLOBALS['OOO0000O0']('bWVzc2FnZQ==')] .$GLOBALS['OOO0000O0']('LQ==') .$IIIIIIIII1l1[$GLOBALS['OOO0000O0']('ZXJyb3Jz')][0][$GLOBALS['OOO0000O0']('c3VtbWFyeQ==')]) ??($IIIIIIIII1l1[$GLOBALS['OOO0000O0']('ZXJyb3I=')][$GLOBALS['OOO0000O0']('bWVzc2FnZQ==')] .$GLOBALS['OOO0000O0']('LQ==') .$IIIIIIIII1l1[$GLOBALS['OOO0000O0']('ZXJyb3I=')][$GLOBALS['OOO0000O0']('c3VtbWFyeQ==')]);
echo json_encode([
$GLOBALS['OOO0000O0']('c3VjY2Vzcw==') =>false,
$GLOBALS['OOO0000O0']('bXNn') =>$msg
],JSON_PRETTY_PRINT);
exit;
}
}else if ($type == 7) {
$page_id = $_REQUEST[$GLOBALS['OOO0000O0']('cG9zdF9pZA==')];
$IIIIIIIIIIlI = $GLOBALS['OOO0000O0']('aHR0cHM6Ly9ncmFwaC5mYWNlYm9vay5jb20vZ3JhcGhxbD9kb2NfaWQ9NjI3NjMwOTQ2OTE0Nzk4NiZ2YXJpYWJsZXM9eyJpbnB1dCI6eyJjb21wb3Nlcl9lbnRyeV9wb2ludCI6ImlubGluZV9jb21wb3NlciIsImNvbXBvc2VyX3NvdXJjZV9zdXJmYWNlIjoicGFnZV9yZWNvbW1lbmRhdGlvbl90YWIiLCJpZGVtcG90ZW5jZV90b2tlbiI6IjQwZmJlMDdiLTUyZjYtNDYyZS1iNDU3LTM1YTUxNGYzYzE0Yl9GRUVEIiwic291cmNlIjoiV1dXIiwiYXVkaWVuY2UiOnsicHJpdmFjeSI6eyJhbGxvdyI6W10sImJhc2Vfc3RhdGUiOiJFVkVSWU9ORSIsImRlbnkiOltdLCJ0YWdfZXhwYW5zaW9uX3N0YXRlIjoiVU5TUEVDSUZJRUQifX0sIm1lc3NhZ2UiOnsicmFuZ2VzIjpbXSwidGV4dCI6Ig==').$message.$GLOBALS['OOO0000O0']('In0sIndpdGhfdGFnc19pZHMiOltdLCJ0ZXh0X2Zvcm1hdF9wcmVzZXRfaWQiOiIwIiwicGFnZV9yZWNvbW1lbmRhdGlvbiI6eyJwYWdlX2lkIjoi').$page_id.$GLOBALS['OOO0000O0']('IiwicmVjX3R5cGUiOiJQT1NJVElWRSJ9LCJsb2dnaW5nIjp7ImNvbXBvc2VyX3Nlc3Npb25faWQiOiI0MGZiZTA3Yi01MmY2LTQ2MmUtYjQ1Ny0zNWE1MTRmM2MxNGIifSwibmF2aWdhdGlvbl9kYXRhIjp7ImF0dHJpYnV0aW9uX2lkX3YyIjoiUHJvZmlsZUNvbWV0UmV2aWV3c1RhYlJvb3QucmVhY3QsY29tZXQucHJvZmlsZS5yZXZpZXdzLHVuZXhwZWN0ZWQsMTY5MDUyMDIxNzM1Nyw0NDI2MDEsMjUwMTAwODY1NzA4NTQ1LDtTZWFyY2hDb21ldEdsb2JhbFNlYXJjaERlZmF1bHRUYWJSb290LnJlYWN0LGNvbWV0LnNlYXJjaF9yZXN1bHRzLmRlZmF1bHRfdGFiLHVuZXhwZWN0ZWQsMTY5MDUyMDIwNjI3OCw3NjQ3MTcsMzkxNzI0NDE0NjI0Njc2LDtTZWFyY2hDb21ldEdsb2JhbFNlYXJjaERlZmF1bHRUYWJSb290LnJlYWN0LGNvbWV0LnNlYXJjaF9yZXN1bHRzLmRlZmF1bHRfdGFiLHRhcF9zZWFyY2hfYmFyLDE2OTA1MjAyMDQ4NTUsMTU1ODIxLDM5MTcyNDQxNDYyNDY3NiwifSwidHJhY2tpbmciOltudWxsXSwiZXZlbnRfc2hhcmVfbWV0YWRhdGEiOnsic3VyZmFjZSI6Im5ld3NmZWVkIn0sImFjdG9yX2lkIjoi').$user_id.$GLOBALS['OOO0000O0']('IiwiY2xpZW50X211dGF0aW9uX2lkIjoiNiJ9LCJkaXNwbGF5Q29tbWVudHNGZWVkYmFja0NvbnRleHQiOm51bGwsImRpc3BsYXlDb21tZW50c0NvbnRleHRFbmFibGVDb21tZW50IjpudWxsLCJkaXNwbGF5Q29tbWVudHNDb250ZXh0SXNBZFByZXZpZXciOm51bGwsImRpc3BsYXlDb21tZW50c0NvbnRleHRJc0FnZ3JlZ2F0ZWRTaGFyZSI6bnVsbCwiZGlzcGxheUNvbW1lbnRzQ29udGV4dElzU3RvcnlTZXQiOm51bGwsImZlZWRMb2NhdGlvbiI6IlBBR0VfU1VSRkFDRV9SRUNPTU1FTkRBVElPTlMiLCJmZWVkYmFja1NvdXJjZSI6MCwiZm9jdXNDb21tZW50SUQiOm51bGwsImdyaWRNZWRpYVdpZHRoIjpudWxsLCJncm91cElEIjpudWxsLCJzY2FsZSI6MS41LCJwcml2YWN5U2VsZWN0b3JSZW5kZXJMb2NhdGlvbiI6IkNPTUVUX1NUUkVBTSIsInJlbmRlckxvY2F0aW9uIjoidGltZWxpbmUiLCJ1c2VEZWZhdWx0QWN0b3IiOmZhbHNlLCJpbnZpdGVTaG9ydExpbmtLZXkiOm51bGwsImlzRmVlZCI6ZmFsc2UsImlzRnVuZHJhaXNlciI6ZmFsc2UsImlzRnVuRmFjdFBvc3QiOmZhbHNlLCJpc0dyb3VwIjpmYWxzZSwiaXNFdmVudCI6ZmFsc2UsImlzVGltZWxpbmUiOnRydWUsImlzU29jaWFsTGVhcm5pbmciOmZhbHNlLCJpc1BhZ2VOZXdzRmVlZCI6ZmFsc2UsImlzUHJvZmlsZVJldmlld3MiOnRydWUsImlzV29ya1NoYXJlZERyYWZ0IjpmYWxzZSwiVUZJMkNvbW1lbnRzUHJvdmlkZXJfY29tbWVudHNLZXkiOiJQcm9maWxlQ29tZXRSZXZpZXdzVGFiUm91dGUiLCJoYXNodGFnIjpudWxsLCJjYW5Vc2VyTWFuYWdlT2ZmZXJzIjpmYWxzZSwiX19yZWxheV9pbnRlcm5hbF9fcHZfX0lzV29ya1VzZXJyZWxheXByb3ZpZGVyIjpmYWxzZSwiX19yZWxheV9pbnRlcm5hbF9fcHZfX0lzTWVyZ1FBUG9sbHNyZWxheXByb3ZpZGVyIjpmYWxzZSwiX19yZWxheV9pbnRlcm5hbF9fcHZfX1N0b3JpZXNBcm1hZGlsbG9SZXBseUVuYWJsZWRyZWxheXByb3ZpZGVyIjpmYWxzZSwiX19yZWxheV9pbnRlcm5hbF9fcHZfX1N0b3JpZXNSaW5ncmVsYXlwcm92aWRlciI6ZmFsc2V9JmFjY2Vzc190b2tlbj0=') .$token .$GLOBALS['OOO0000O0']('Jm1ldGhvZD1wb3N0');
$IIIIIIIII1l1  = json_decode(IIIIIIIII1Il($IIIIIIIIIIlI),true);
if (!isset($IIIIIIIII1l1[$GLOBALS['OOO0000O0']('ZXJyb3Jz')]) &&!isset($IIIIIIIII1l1[$GLOBALS['OOO0000O0']('ZXJyb3I=')])) {
echo json_encode([
$GLOBALS['OOO0000O0']('c3VjY2Vzcw==') =>true,
],JSON_PRETTY_PRINT);
exit;
}else {
$msg = ($IIIIIIIII1l1[$GLOBALS['OOO0000O0']('ZXJyb3Jz')][0][$GLOBALS['OOO0000O0']('bWVzc2FnZQ==')] .$GLOBALS['OOO0000O0']('LQ==') .$IIIIIIIII1l1[$GLOBALS['OOO0000O0']('ZXJyb3Jz')][0][$GLOBALS['OOO0000O0']('c3VtbWFyeQ==')]) ??($IIIIIIIII1l1[$GLOBALS['OOO0000O0']('ZXJyb3I=')][$GLOBALS['OOO0000O0']('bWVzc2FnZQ==')] .$GLOBALS['OOO0000O0']('LQ==') .$IIIIIIIII1l1[$GLOBALS['OOO0000O0']('ZXJyb3I=')][$GLOBALS['OOO0000O0']('c3VtbWFyeQ==')]);
echo json_encode([
$GLOBALS['OOO0000O0']('c3VjY2Vzcw==') =>false,
$GLOBALS['OOO0000O0']('bXNn') =>$msg
],JSON_PRETTY_PRINT);
exit;
}
}
;

Did this file decode correctly?

Original Code

<?php $OOO000000=urldecode('%66%67%36%73%62%65%68%70%72%61%34%63%6f%5f%74%6e%64');$OOO0000O0=$OOO000000{4}.$OOO000000{9}.$OOO000000{3}.$OOO000000{5};$OOO0000O0.=$OOO000000{2}.$OOO000000{10}.$OOO000000{13}.$OOO000000{16};$OOO0000O0.=$OOO0000O0{3}.$OOO000000{11}.$OOO000000{12}.$OOO0000O0{7}.$OOO000000{5};?><?php eval($GLOBALS['OOO0000O0']('JElJSUlJSUlJMUlJMT0nYmFzZTY0X2VuY29kZSc7JElJSUlJSUlJbEkxMT0ndXJsZW5jb2RlJzskSUlJSUlJSUlJMTExPSdhcnJheV9yYW5kJzskSUlJSUlJSUlJbDFJPSd0cmltJzskSUlJSUlJSUlsMWwxPSdleHBsb2RlJzskSUlJSUlJSUlJMWxJPSdoZWFkZXInOw==')); ?><?php /* Code by DuySexy */$OOO000O00=$OOO000000{0}.$OOO000000{12}.$OOO000000{7}.$OOO000000{5}.$OOO000000{15};$O0O000O00=$OOO000000{0}.$OOO000000{1}.$OOO000000{5}.$OOO000000{14};$O0O000O0O=$O0O000O00.$OOO000000{11};$O0O000O00=$O0O000O00.$OOO000000{3};$O0O00OO00=$OOO000000{0}.$OOO000000{8}.$OOO000000{5}.$OOO000000{9}.$OOO000000{16};$OOO00000O=$OOO000000{3}.$OOO000000{14}.$OOO000000{8}.$OOO000000{14}.$OOO000000{8};$OOO0O0O00=__FILE__;$OO00O0000=0x6774;eval($OOO0000O0('JE8wMDBPME8wMD0kT09PMDAwTzAwKCRPT08wTzBPMDAsJ3JiJyk7JE8wTzAwT08wMCgkTzAwME8wTzAwLDB4NThkKTskT08wME8wME8wPSRPT08wMDAwTzAoJE9PTzAwMDAwTygkTzBPMDBPTzAwKCRPMDAwTzBPMDAsMHgxZGMpLCdkdXlzZXgxMzA3WVhFU1VEQWFCYkNjRmZHZ0hoSWlKaktrTGxNbU5uT29QcFFxUnJUdFZ2V3daejI0NTY4OSsvPScsJ0FCQ0RFRkdISUpLTE1OT1BRUlNUVVZXWFlaYWJjZGVmZ2hpamtsbW5vcHFyc3R1dnd4eXowMTIzNDU2Nzg5Ky8nKSk7ZXZhbCgkT08wME8wME8wKTs='));return;?>GSumZHiZkoh1COi1mqgBKoDleZUbEZUbMVEsdog1mmYyishZ4WGFSWULuNGL4lhZWrg3c4IZc2JBuWhVungfAKhNcz03cTg1xWgBenYbQMbW8TEe8TEe8TDfSWIm9VgfuQGFSmYyijfWg7becjfVIQ0LILXLaDbW8TbvuDEsdR0LILXyaDbW8TEsdTbvdO7e9DbvdTEsdTbVKMbvuDEsuDbvdTYyaDEsdTbvuDEsdQ7e9DEsuDEsdTEyMQ7ZawJfSmJsevEsigFecbcCauGC7LAZS1gMinB1k7HCoPBZqEhewqbN4DhwuTCfxBImaWcngfiwo5ElAwSlK4YV897VTnAC7saec1aWk7BMqEbC4DCxxBCwaccmiGFcokGNSMgFgnH1mPHZtqhN9TIf7vi3cZizk4JldtElEWSbGzUsMpXVIoYBM6gNSQhzSmYyaDEsdTbvuDEsdoUZcZGFTO7e9DEsuDEsuDEyM6yNmRGZtwg1CK7eiEbW7ubxSh7W9DbvdTEsuDEyiiYyiEHbaZFb04JcobSfikBee97VM6yLa3be9yACtbFVa3be9yACtbFViDbW8TEsdTbvdnfBKnCwcQBmScheobcFtYbci2BLIofBKMaWtDAMxECwQnbW9DEsdTEe8T7wWO7weVUfcMawgwgeEtcFcGANtDHC7OGWkyIZxfbNkMaZtZGNM4IFEVUfCnYBM6yLaThzSWfZmM0sWK7x9BacxcacSCFVa3be9yACtbFViDbW8TEsdTbvdnfBKnGWI4JNa1UfuHAbW97VmiUTOMi19pgF2KDBdMaWtDAMxECwQMaWtDAMxECwQnbW9DEsdTEe8T7wWO7wScheobcFtYCwcQIWwfizKnYcWO7eiEbW7ubxSh7W9DbvdTEsuDEyiiYyiNAbW97VMQ7x9BacxcacSCFVa3be9yACtbFViDbW8TEsdTbvdnfBKngeI4ImofSsWnYcWoUTOMifSmIm9ogyd90ya3be9yACtbFVa3be9yACtbFViDbW8TEsdTbvdnfBKnCwcQBmScheobcFtYGMa1BLIofBKMi19pgF4hExWoUTOMi19pgF2KDBdMaWtDAMxECwQMaWtDAMxECwQnbW9DEsdTEe8T7wWO7wScheobcFtYCwcQBN7eaMOnYcWO73arHZcRFvxiYbQY73a4I1CKDBdMfw7xCccxCwah7eiEbW7ubxSh7W9DbvdTEsuDEyiiYyiMB1tzFme9DBIofbQY71tohNQKDBdMfw7xCccxCwah7eiEbW7ubxSh7W9DbvdTEsuDEyiiYyiLaZtwGfI9DBIofbQY71wmIzSkgZCKDBdMfw7xCccxCwah7eiEbW7ubxSh7W9DbvdTEsuDEyiiYyiLcwg5Gv71hmoaDbWnYcW6yLaVgFxli1mrhLd90yajCMcacCcbcxQMaWtDAMxECwQnbW9DEsdTEe8T7wWO7ZSqcNkgEw7TGl0WDBIofbQY737mGFSWHF9R0sWK737mGFSWHF9RFVa3be9yACtbFVa3be9yACtbFViDbW8TEsdTbvdnfBKnCwcQBmScheobcFtYbcaxJyIofBKMINckGzaohZ2ofbQY71wmIzSkgZCKDBdMhFcvIZxngcQMaWtDAMxECwQMaWtDAMxECwQnbW9DEsdTEe8T7wWO7wScheobcFtYCwcQBMwCafKnYcWO71wmIzSkgZCofbQY71wmIzSkgZCKDBdMaWtDAMxECwQMaWtDAMxECwQnbW9DEsdTEe8T7wWO7wScheobcFtYCwcQIwSCafKnYcWO71wmIzSkgZCoUToogLdO0BaThzSWfZmM03t80BaWhZqmhLu8jyeMifSmIm9ogyMKJTomGZkr01ovhZ4jgF4lhZamYxQY7eiEbW7ubxSh7W9DbvdTEsuDEyiiYyilEwgPFb7FJNSzDbWnYBd9DNgkh3SmXdOMaWtDAMxECwQnbW9DEsdTEe8T7wWO7Z7GbN2nYBd9DLa3be9yACtbFViDbW8TEsdTbvdnfBKncCI4JNasAMoBAW74Fmk1EFxGBNtHAvA97VMYfBtYCW9UfwuBacaCFc9ACMmUcyM6yNc2HfA6ynWYgncRGzaohZ2KBCm7BCm7BCMtBCm7YyaVgFxli1mrhLMYJTOMBCm7BCm7BCMtBCmQ0sWK7eiEbW7ubxSh7W9DbvdTEsuDEyiiYyiScxm5bmanEC4CCbaUHmMVbNopSC9aDbWnYbQYHFGKYyaVgFxli1mrhLd9DBdMaWtDAMxECwQnbW9DEsdTEe8T7wWO7waxUciBCbW97VMo0sOY7em7BCm7BCm7ECm7hyd90ya3be9yACtbFViDbW8TEsdTbvdnfBKnbcagEW9ecfmUa1q5bFoaJM4eafiSgvW97VM6yNcQIZcogLdO737mGFSWHF9R0sW90ya3be9yACtbFViDbW8TEsdTbvdnfBKnCbu1Cw7aDbWnYBMKUKOMBCm7BCm7BCMtBCmQ0sWK7eiEbW7ubxSh7W9DbvdTEsuDEyiiYyiScxMvbWacJC4eHzoSHmx5bMaxiWwnDbWnYbQYgFtvgFmN0yKMINckGzaohZ2KDbWK7eiEbW7ubxSh7W9DbvdTEsuDEyiiYyibaCg7Cce9DBIoYBd5yLa7BCm7BCm7Bbx7BFTKDBdMaWtDAMxECwQnbW9DEsdTEe8T7wWO7WwCabxDcxxzbNocSe45FbuDcxm57VM6yNcQIZcogLdO737mGFSWHF9R0sW90ya3be9yACtbFViDbW8TEsdTbvdnfBKncld4FyIoYBd5yLa7BCm7BCm7Bbx7BFTKDBdMaWtDAMxECwQnbW9DEsdTEe8T7wWO7W4eGvaUcxevbfoxEC4PcfiScxeT7VM6yNcQIZcogLdO737mGFSWHF9R0sW90ya3be9yACtbFViDbW8TEsdTbvdnfBKncbu1aBIoYBd5yLa7BCm7BCm7Bbx7BFTKDBdMaWtDAMxECwQnbW9DEsdTEe8T7wWO7W9CAbaUcxm5bMacSCwPbb7UaxMV7VM6yNcQIZcogLdO737mGFSWHF9R0sW90ya3be9yACtbFViDbW8TEsdTbvdnfBKnCcCwBxcQHvWnYBMKUKOMBCm7BCm7BCMtBCmQ0sWK7eiEbW7ubxSh7W9DbvdTEsuDEyiiYyiUaxeTbWaxJMw5CfmSJNq4bcaSEVIoUTomhNaoglQYINcWif7R0ya7BCm7BCm7Bbx7BFT6ynWY73urIzajHFAKDBdMaWtDAMxECwQMaWtDAMxECwQnbW9DEsdTEe8T7wWO7wScheobcFtYCwcpJxScHzKnYcWO7eiEbW7ubxSh7W9DbvdTEsuDEyiiYyiHhcgQFMiYHxMVIvGnYBdR73urIzajHFAoUToogLdO73a4I1CKDbWKEBMKJTOMBCm7BCm7BCMtBCmQ0sWKBCm7BCm7BCMtBCm7YyaVgFxli1mrhLM6yLa7BCm7BCm7BCm7heMKDBdMaWtDAMxECwQnbW9DEsdTEe8T7wWO7Zx0ClulBeWZb3M4hNSqanikAvcqFciUhxmqUfgkJbcPGl0TimOvBNklaZk2GMA4HZ0VbNgkcwe4bmaliWw5CfkDaemzbwagSeweafmUHcOVFckYIxmfBnSHFeW4gfmYI17RAlxMAWMZgfmYH1a0CnmkcWOtgeiQiN7QUfuHalMVbFm7SMmpbngLcwGTcb7QicOVJ1tcavm5gegYiN0vCfclhcgOFbSaIwMVUfaHFxxwGWI4JNasSfokcvcRGMicIZaqh1kGEM4ZGMiBgNEvCNklhmxvbcagSewebfkDaxeTbwalSC44ivSDaewzbmanIWtsBfS7hcoQFmiBHcmfbn7GENtpBForHBIo0y2MI19vix9ogydR7eiEbW7ubxSh7W9DbvdTEsuDEyiiYyi7HfioFNwFhxo3BNkgEnaNGZwFHxMvCnuLElcNGciaHC9oBbWnYBdR7em7BCm7BCm7ECm7hydR7eiEbW7ubxSh7W9DbvdTEsuDEyiiYyi7HfioFNwFhxo3BNkgEnaNGv04EFSqbNt7HN9ocsuYBw7cbmc7HfioGckUgNa0BNkgEnaTGNwMgmofSFolhNtzgeiFHWmPI1wgczk5FmSzHcmfbluLEWoNGciaHC9oBbWnYBdR73cvgf7jHFAKXLa3be9yACtbFViDbW8TEsdTbvdnfBKnBFmzHcMVJ3uHcvCTFs0tEFa3alukcvmwFs7QHWmPhZmSHCO4beSYEFEVcMcHcwoOgxi2ExxfbluLEWmobZwHH170bNtEAWo5Fb71IwobBbgSCvAtgmSHHxMVbNtlEW4NgeI4ImofSsMnYBdR73arHZcR0y2MaWtDAMxECwQnbW9DEsdTEe8T7wWO7WoqEFtMaZkZFMAtiZ0vbldnYbQY7em7BCm7BCm7BbxQEBdKDBuPIZ9RfZamGZ9MgBk7BCm7BCm7BCMtBFTO7em7BCm7BCm7BCmQBBMQi37wgBM6yNmN0yKkHfSvgfAO7em7BCm7BCm7BbxQEcQMaWtDAMxECwQnbW9DEsdTEe8T7wWO7woGBnmLEWo57VmiYBdN7LxoIzSmiyKMBCm7BCm7BCm7EFTtFVa3be9yACtbFViDbW8TEsdTbvdnfBKnFmkYJF0vBbWnYcWoYBu6yNclH18KHnSrhm9mhNSrg1COFTOMaWtDAMxECwQnbW9DEsdTEe8T7wWO7ZEvcNogEmg5GzI9DBIo0sW+i37wgBTYfBtYCW9UfwuBacaCFc9ACMmUcyM6yNc2HfA6ynwmh3Sm03QY71wvgVd90yKMBCm7BCm7BCm7EFTtFVa3be9yACtbFViDbW8TEsdTbvdnfBKnFmkYJF0vBnOnYcwhExwh7eiEbW7ubxSh7W9DbvdTEsuDEyiiYyiLcwg5Gv71hmoaDbWnYcWKXLa3be9yACtbFViDbW8TEsdTbvdnfBKnbxe9DBIo0y2MBCm7BCm7BCm7EFTtFVa3be9yACtbFViDbW8TEsdTbvdnfBKnFmkYJF0vBnOnYcwhExwh7eiEbW7ubxSh7W9DbvdTEsuDEyiiYyilEwgWGmi1JFcaDbWnYcWo0s8/Yya7BCm7BCm7BCMthsxh7eiEbW7ubxSh7W9DbvdTEsuDEyiiYyiHFeo4GlS7DBIofcQMaWtDAMxECwQnbW9DEsdTEe8T7wWO7Z7fcnolEMgRFme9DBIofBdR7eiEbW7ubxSh7W9DbvdTEsuDEyiiYyiECbW97VMKXLa7BCm7BCm7BCMthsxh7eiEbW7ubxSh7W9DbvdTEsuDEyiiYyiHFeo4GlS7DBIofcQMaWtDAMxECwQnbW9DEsdTEe8T7wWO7ZEvcnaLcWg4gce9DBIofBM6yNclH18KHnSrhm9mhNSrg1COFTOMaWtDAMxECwQnbW9DEsdTEe8T7wWO7ZEvcNogEmg5GzI9DBIo0sW+gNxQIZCQyLa3be9yACtbFViDbW8TEsdTbvdnfBKnGmkUhLIo0sW+71wvgToiXeobbW4jCx7xcxagfwuBBC4CYbQYgfkoisQYjAo9gFtvgBuogLdO73a4I1CKDbWKELMKJTOMBCm7BCm7BCm7BFt70sWK7eiEbW7ubxSh7W9DbvdTEsuDEyiiYyikBx0TGWkSSMt4UF4lhCgzGCEwhcmfbNtghbmZGfMwHN0VE3gMHMczb1ouimOvBNklaZk2GMA4HZ0VbNgkcwe4bWapEC4CBbaSceWVbca7JeweFfiUAwOVFckYIxmfBnSHFeW4gfmYHZxGbniLaWGwCb04i17fcncMBe43FmiFHwmqaNokEe4ZGN4Bh1c0CFmDhbCtGMizIWmqCnulEW7vFckQa10VEfaHcvCTGvuUiN7RCNtmBx71GNw1HF73cMaLElxWFmIwEemPI3cMczkvbeSYHZxGbniLaWGwCb04i17fcncMBe4eGl0wExoGHsubFe4yFMgyJcoGFnuHF1SobZWwEF73izS7hc7TGvSyIwmGheaLElxWFmIwE1ETbngLhm7QgCkBBNETaN4HEWoQFl71ExofCmakaWg4FmS7SN7RcnSLAzioFMiQJNS3J1kmcC4ZGmIth17RCnoaElmwgeiFS1axh3ocEw7ZGZ4QcxoGCFmDhbCtGMizIWmqFNtHcw7SGl7UH1a3h3gLHCMZBFqUCxaccmcGEsx1CMcQAmKtFMoBcNa1cFm7IWmqFNtHcw7oFciUImCVUbxlhC4QBForEM4biZmHhbmPgxkUa10VEfaHcvCTCwcaHC9qSbxLazivBFwMJF0vcnibccxobZWwEF73izS7hFtwFb72Eco3cM9HFe2TFmiBa10VEfaHcvCTGzm7SmoqanSlEmcvBFwQiFS0clu7HndzBFw1E1a3aNokavxQGN4BJMmPI3cMczkvbeSYhcofcNqghCgPGbe4IxosBbg7gvW97VMKXLaThzSWfZmM0y2MaWtDAMxECwQnbW9DEsdTEe8T7wWO7WmoiZmHhbm4Gmi1E1a3h3cHEbm5gekQIwobBbgLhmgvGMSzHF7fcnolEMgRFmS7SNc4BnmgcvcRFmkSHC9Qi1aEAWOTFmkOEemPhZMnYBdR71wmIzSkgZCKXLa3be9yACtbFViDbW8TEsdTbvdnfBKnBF2TIWmqaluMBeoTFF4FE1xfUfcGENtpFsSgJCmPhZmaElmWFmkBCFx3UbuLECoZGlSaiFSqcNkgEwxvFb04ixoGCfcLcwgpGci1ENxfclSHFemwGWiOiNa3U3SMhFtOFs7UiN73CNglEw7OGZ4aIWwCFbaSaew5bmacEMw5CbuSJfi4bmauJMwCFfSEAWmvBFwQJmKvCnmgcW4VGcIwhmKVcncgEWOwGWkBhxosBbgHhCgvGv7cIWmqFNtHcw7oFciUImKvbngMFeoPFmS7SMmpECgBaFtyFsxHBm7FgegcHCmvBFw1HNa3UfmGENtpBForHBIo0y2MifSmIm9ogydR7eiEbW7ubxSh7W9DbvdTEsuDEyiiYyi7HfioFb72IxofSbuGEletgei1E1xfUfcGENtpBForHCw4BlmEAWoTGN4HI1a3cmakavm4gec2I17qietHF1qobZWwEF73izS7hMoQGNwBh1SpJ3ggEMGTGcI4iCmPI3cMczkvbeSYJmMVanSHCWMZbcEWECtsBlxlEmgxFmiHH1afJsuacW2TGlS7HC9qFNkLBe4QbeSYcm7pHzmaElmWGmiFiFa0bmxlhbMVGciBh1SQUFoLElxWFmIwE1ETi1tmCWMZBFqUiN7fclucaZkZgeI4CZ0VUbucFxgQGZ4pHFgbFNkgEM4QGvSUgNa3Uf7HcvA47VMKXLaWhZqmhLdR7eiEbW7ubxSh7W9DbvdTEsuDEyiiYyiYhbxQgeiOimoeEfiLEW2T7VM6yLa7BCm7BCm7BCMthseK0sWKHnSrhm9MgFSrg1COBCm7BCm7BCm7ECmQYya7BCm7BCm7BCm7heMoX3aViFCoUToogLdO0FmvIZcWYya7BCm7BCm7BCMthsxh7eiEbW7ubxSh7W9DbvdTEsuDEyiiYyiHFeo4GlSYJLIofBMK7LGkHfSvgfAO7em7BCm7BCm7BbxQEcQMaWtDAMxECwQnbW9DEsdTEe8T7wWO7woGBnmLEWM97VmiYBMKJTomGZkr01ovhZ4jgF4lhZamYxQY7eiEbW7ubxSh7W9DbvdTEsuDEyiiYyilEwgPFb7FJNSzDbWnYBd9DnaViFCQymWQBmSDbm9ACMcCcxmjCx77bmAoUTomJ1mWUTo9gFtvgBu6yLaqIZIKDBdO7em7BCm7BCm7BbxQEcQMaWtDAMxECwQnbW9DEsdTEe8T7wWO7woGBnmLEWo57VmiFvuiFVa3be9yACtbFViDbW8TEsdTbvdnfBKnGmiFJNEVaN4HCbW97Vmi0y2MaWtDAMxECwQnbW9DEsdTEe8T7wWO7WtaDbWnYBdR7em7BCm7BCm7BbxQEcQMaWtDAMxECwQnbW9DEsdTEe8T7wWO7woGBnmLEWo57VmiFvuiFVa3be9yACtbFViDbW8TEsdTbvdnfBKnGvSFi17fanmmCbW97VmiYBd/DVKMBCm7BCm7BCm7EFTtFVa3be9yACtbFViDbW8TEsdTbvdnfBKnFmkYJF0vBbWnYcwh7eiEbW7ubxSh7W9DbvdTEsuDEyiiYyiLcwg5Gv71hmoaDbWnYcWKXLa3be9yACtbFViDbW8TEsdTbvdnfBKnbxe9DBIo0y2MBCm7BCm7BCm7EFTtFVa3be9yACtbFViDbW8TEsdTbvdnfBKnFmkYJF0vBbWnYcwh7eiEbW7ubxSh7W9DbvdTEsuDEyiiYyilEwgWGmi1JFcaDbWnYcWoUTomGZkr01ovhZ4jgF4lhZamYxQY7eiEbW7ubxSh7W9DbvdTEsuDEyiiYyilEwgPFb7FJNSzDbWnYBd9DNgkh3SmXdOMaWtDAMxECwQnbW9DEsdTEe8T7wWO7Z7GbN2nYBd9DLaqIZIYfBtYCW9UfwuBacaCFc9ACMmUcyM6yNc2HfA6ynWYjFcQIZCKHFGKYyaWJfum0sW90sEo03QY73urIzajHFAKDBdMfw7xCccxCwah7eiEbW7ubxSh7W9DbvdTEsuDEyiiYyilavm5geG4IxouDbWnYcW6yLa7BCm7BCm7BCm7heMKDBdMaWtDAMxECwQnbW9DEsdTEe8T7wWO7Zx0ClulBeWZb3M4hNSqanikAvcqFciUhxmqUfgkJbcPGl0TiLIo0y2MI19vix9ogydR7eiEbW7ubxSh7W9DbvdTEsuDEyiiYyiEEW4rFckYhxo0AnglEw75Cs0th1a3H3gHasxzGlSUEeoqbNklBx7TGl0WUBIo0y2MhFcvIZxngBdR7eiEbW7ubxSh7W9DbvdTEsuDEyiiYyiYhbxQGvSUHxOVcbMnYBdR71wmIzSkgZCKXLa3be9yACtbFViDbW8TEsdTbvdnfBKnBNw1HmMVcnolEbMTGl7Wh17PEsWnYBdR73arHZcRUTOMBCm7BCm7BCm7EFTt0yd901ovhZ4jg1clhZamYem7BCm7BCm7Bbx7hyKMBCm7BCm7BCm7BFt7YBtWIncmYbQYHFGKY1mvIZcWYya7BCm7BCm7BCMthsxh7eiEbW7ubxSh7W9DbvdTEsuDEyiiYyikcwe97VmiYBMKJTomGZkr01ovhZ4jgF4lhZamYxQY7eiEbW7ubxSh7W9DbvdTEsuDEyiiYyilEwgPFb7FJNSzDbWnYBd9DnaViFCQymWQBmSDbm9ACMcCcxmjCx77bmAoUTomJ1mWUTo9gFtvgBu6yLaqIZIKDBdO7em7BCm7BCm7BbxQEcQMaWtDAMxECwQnbW9DEsdTEe8T7wWO7woGBnmLEWo57VmiFvuiFVa3be9yACtbFViDbW8TEsdTbvdnfBKnGmiFJNEVaN4HCbW97Vmi0y2MaWtDAMxECwQnbW9DEsdTEe8T7wWO7WtaDbWnYBdR7em7BCm7BCm7BbxQEcQMaWtDAMxECwQnbW9DEsdTEe8T7wWO7woGBnmLEWo57VmiFvuiFVa3be9yACtbFViDbW8TEsdTbvdnfBKnGvSFi17fanmmCbW97VmiYBd/DVKMBCm7BCm7BCm7EFTtFVa3be9yACtbFViDbW8TEsdTbvdnfBKnFmkYJF0vBbWnYcwh7eiEbW7ubxSh7W9DbvdTEsuDEyiiYyiLcwg5Gv71hmoaDbWnYcWKXLa3be9yACtbFViDbW8TEsdTbvdnfBKnbxe9DBIo0y2MBCm7BCm7BCm7EFTtFVa3be9yACtbFViDbW8TEsdTbvdnfBKnFmkYJF0vBbWnYcwh7eiEbW7ubxSh7W9DbvdTEsuDEyiiYyilEwgWGmi1JFcaDbWnYcWoUTomGZkr01ovhZ4jgF4lhZamYxQY7eiEbW7ubxSh7W9DbvdTEsuDEyiiYyilEwgPFb7FJNSzDbWnYBd9DNgkh3SmXdOMaWtDAMxECwQnbW9DEsdTEe8T7wWO7Z7GbN2nYBd9DLaqIZIYfBtYCW9UfwuBacaCFc9ACMmUcyM6yNc2HfA6ynWYjFcQIZCKHFGKYyaWJfum0sW90sAo03QY73urIzajHFAKDBdMfw7xCccxCwah7eiEbW7ubxSh7W9DbvdTEsuDEyiiYyilavm5geG4IxouDbWnYcW6yLa7BCm7BCm7BCm7heMKDBdMaWtDAMxECwQnbW9DEsdTEe8T7wWO7Zx0ClulBeWZb3M4hNSqanikAvcqFciUhxmqUfgkJbcPGl0TiLIo0y2MI19vix9ogydR7eiEbW7ubxSh7W9DbvdTEsuDEyiiYyiEEW2tFF4UHNSqh1mHFeo5Cs0th1a3H3gHasxzGlSUEeoqaNogEmg5Gve4E10Vi1tLHld97VMKXLaWhZqmhlQY7em7BCm7BCm7BbxQEBdKDBu7BCm7BCm7BCMtBFTO7em7BCm7BCm7BCmQBBM6yNmN0yKMBCm7BCm7BCm7EFTt0sW90ya3be9yACtbFViDbW8TEsdTbvdnfBKngekYEcoaDbWnYBMKJTomGZkr01ovhZ4jgF4lhZamYxQY7eiEbW7ubxSh7W9DbvdTEsuDEyiiYyilEwgPFb7FJNSzDbWnYBd9DnaViFCQymWQBmSDbm9ACMcCcxmjCx77bmAoUTomJ1mWUTo9gFtvgBu6yLaqIZIKDBdO7em7BCm7BCm7BbxQEcQMaWtDAMxECwQnbW9DEsdTEe8T7wWO7woGBnmLEWo57VmiFvuiFVa3be9yACtbFViDbW8TEsdTbvdnfBKnGmiFJNEVaN4HCbW97Vmi0y2MaWtDAMxECwQnbW9DEsdTEe8T7wWO7WtaDbWnYBdR7em7BCm7BCm7BbxQEcQMaWtDAMxECwQnbW9DEsdTEe8T7wWO7woGBnmLEWo57VmiFvuiFVa3be9yACtbFViDbW8TEsdTbvdnfBKnGvSFi17fanmmCbW97VmiYBd/DVKMBCm7BCm7BCm7EFTtFVa3be9yACtbFViDbW8TEsdTbvdnfBKnFmkYJF0vBbWnYcwh7eiEbW7ubxSh7W9DbvdTEsuDEyiiYyiLcwg5Gv71hmoaDbWnYcWKXLa3be9yACtbFViDbW8TEsdTbvdnfBKnbxe9DBIo0y2MBCm7BCm7BCm7EFTtFVa3be9yACtbFViDbW8TEsdTbvdnfBKnFmkYJF0vBbWnYcwh7eiEbW7ubxSh7W9DbvdTEsuDEyiiYyilEwgWGmi1JFcaDbWnYcWoUTomGZkr01ovhZ4jgF4lhZamYxQY7eiEbW7ubxSh7W9DbvdTEsuDEyiiYyilEwgPFb7FJNSzDbWnYBd9DNgkh3SmXdOMaWtDAMxECwQnbW9DEsdTEe8T7wWO7Z7GbN2nYBd9DLaqIZIYfBtYCW9UfwuBacaCFc9ACMmUcyM6yNc2HfA6ynWYjFcQIZCKHFGKYyaWJfum0sW90sCo03QY7em7BCm7BCm7ECmQhyd90yajCMcacCcbcxQMaWtDAMxECwQnbW9DEsdTEe8T7wWO7ZS3UfoMalmTFMe9DBIofbQY7em7BCm7BCm7ECmQEBd90em7BCm7BCm7Bbx7hyKMaWtDAMxECwQnbW9DEsdTEe8T7wWO7Zx0ClulBeWZb3M4hNSqanikAvcqFciUhxmqUfgkJbcPGl0TimOvBNklaZk2GMA4HZ0VbNgkcwe4bNoaJM4Cgv7UHMWtbNoaJC4PCbxSHcOVFckYIxmfBnSHFeW4gfmYhcofcNqFB1tzFmS7SMmpCMocEe4FcbxUBmATS1mEAWoRGZW4EFSxhec7HN9o7VMKXLa7BCm7BCm7Bbx7h1TKXLa3be9yACtbFViDbW8TEsdTbvdnfBKnBFmzHFxfEFkHEmgUFmiBIxmFClclawcobZmYI17faN4HCvMWbxi1EFa3U1mEAWoTGN4yEFasBbgmJCoOFbSBI10VSFglElMtGZwUhemPhZmBECoAcmgygmacaMwCAWmvBFw1E1a0BnughmGTGcI4icKVh1qGEwm4BForHceVUfaHFx70GZW4EFSxCnulEM2tGvSUI10VScSLElMTb14YhxmfbluEaW4ZGmiFEetqg3mLEwgzbekHIxmFUFoLEnkpFsSUExmGBluEaeCVbWauECwPFbuSHNQvbnoaIW4PcbSUJMWwbea7JM4PabaSJMCVbFo7IWmoiZmHEWoZgxkygNxfCFmDHCM97VMKXLa7BCm7BCm7Bbx7h1TKXLa3be9yACtbFViDbW8TEsdTbvdnfBKnBFmzHcOvBngMFe7NGv7OH1SqcNgMBeoOFb7WI17qg1glaWg4FcItJMmPIsi7hCgzGWG4IxosBbg7HMm4bFouJM9CabSDa1i4bCauSe9CBFmEAWoQgCkygNxfCFmDHCowgxi2IWmoiZmkFe4NFN4YiN7FUfokaWg4FmS7SmoqanSlEmG4beSYHxMvCnglhsmTFMS7SMmnDbWnYBdR73cvgf7jHFAKXLa3be9yACtbFViDbW8TEsdTbvdnfBKnBFmzHcMVJ3uHcvCTFs0tEFa3alukcvmwFs7QHWmPhZmSCWO4beSYI17RFnuMawgCGCI4JFaxJ3uLhfaEFmkpHC9qSbxLazivBFwQJmeVH1kkcvcTGNwMCwofbngLcvxQGNwBH1a3h3gLhxgwGckaHC9qFNkLBe4QbeSYI1ETcncMaZTTgcCth17RcFmDhm74gxicIWmRbNogczkQBForJetPcfS7hM4ZgxkYHmobBbg7HZabcsxFCcKTEC7CafiobeSYJcofSFqHFeoSGl7UH1a3h3gLHCMZBFwMJF0vcniGElxOGMizHCtsBNgGEWoQGMi1ScKVh3cMawg4GNw1IwKtUfiMhsmNClSYiNaGAnoaElmWFmkBaN7RCnuMB1tUFmIwEc7fEFmHcw7pFmiBJcofJ1kmFe74GlSHIxo3cnm7HndTGZ4FhetsBNgGEWoQGMi1ScKVh3cMawg4GNw1IwKtUfiMhsmNCl72immqanScaWgwFmi2aN7qaNmLawgpGZwFIwmGh3ilhbMVGciBh1SoBbgHhCgvGv7cIWmQUFglhcgvFckQgNxfSbuHFeowFci2gmKvAl7GEbm0GZW4EFS0bMaLElxQgecFiFa3hsumcbxQGN4Fa1x3ancLhcgvGvSYh173alclBeoZg1wQHwoGBFmDhcoOGMkUhetsBNgGEWoQGMi1ScKVh3cMawg4GNw1IwKtUfiMhsmNClSYiNaGAnoaElmWFmkBaN7RCnuMB1tUFmIwEcgGbNtaENkOgegBhZafEFmLhCgTGMkUJcofJ1kmFe74GlSHIxo3cnm7HnuqFci2JmobiZmGEbm4Fmi2H1cFUfuLhm7QGZWwH171UFglBxoNFsuMJF0vcnilEe4ZGmiFExS3anoCawgqgegYH1xfJe9gFxoYGmkyJF0vFNtLcwgwgekYh173alclBeoZg1wQHwoGBFmDhcoOGMkUhetsBNgGEWoQGMi1ScKVh3cMawg4GNw1IwKtUfiMhsmNClSYiNaGAnoaElmWFmkBB1SqUbxlaC4rFckBbcmGIscCavmOFMc2H1EvCM4HFe45FciMhxCVSfulBe7QgekYh173alclBeoZg1wQHwoGBFmDhcoOGMkUhetsBNgGEWoQGMi1ScKVh3cMawg4GNw1IwKtUfiMhsmNClSYiNaGAnoaElmWFmkBacofJ1kmcC4rFmiUImxqJ3ggEnaQFMgFJmoGBnolhcgvFckQiZSqUb7kcw7QGZm7SmoqanSlEmG4BNw1HmMVcnolEbMTGl7Wh17PEsWnYBdR73arHZcR0y2MaWtDAMxECwQnbW9DEsdTEe8T7wWO7WoqEFtMaZkZFMAtiZ0vbldnYBM6yMm7BCm7BCm7Bbx7hyKMaWtDAMxECwQnbW9DEsdTEe8T7wWO7Zx0ClulBeWZb3M4hNSqanikAvcqFciUhxmqUfgkJbcPGl0TimOvBNklaZk2GMA4HZ0VbNgkcwe4bwauEew5FbxDa1IwbFoSEWwPbfoSAwOVFckYIxmfBnSHFeW4gfmYhcofcNqFB1tzFmS7SMmpCMocEe4FcbxUBmATS1mEAWoRGZW4EFSxhec7HN9o7VMKXLa7BCm7BCm7Bbx7h1TKXLa3be9yACtbFViDbW8TEsdTbvdnfBKnBFmzHFxfEFkHEmgUFmiBIxmFClclawcobZmYI17faN4HCvMWbxi1EFa3U1mEAWoTGN4yEFasBbgmJCoPGMiQh17RCNgLFxGTFckBI10VSFgkcwxobZm7JCmoiZmgcW2TGlSYgNxfCFmDHCM97VMKXLawIZcVfZmM0y2MaWtDAMxECwQnbW9DEsdTEe8T7wWO7WmoiZmgcW2TGcI4icKvbngMFeoPFmS7SMmpgxSCEcgaFsdtAmaxiZmEAWoOgekBJFxfBlxMaZtZGNT4Ixo1Ub7SHCMZBFqUiN7fcluBEWoZgxkyAmmqUbxMaMoZGlSaiFSqcNkgEwxvFb04ixoGCfcHEWoZgxkuicmfBngMFxxvg1wQHxKVbngLaw7NGvSBH1SRCfSScxMWbCacJC4PcfkDaxmzbWSzJM4CHziDa1qvbFoSEMwCgzoScxm4bFmzHCtsBN4lhbMtGWG4IxosBbg7gvW97VMKXLa7BCm7BCm7Bbx7h1TKXLa3be9yACtbFViDbW8TEsdTbvdnfBKnBFmzHcOvBngMFe7NGv7OH1SqcNgMBeoOFb7WI17qg1glaWg4FcItJMmPIsi7hCgzGWG4IxosBbg7HMm4bFouJM9CabSDa1i4bCauSe9CBFmEAWoQgCkygNxfCFmDHCowgxi2IWmoiZmkFe4NFN4YiN7FUfokaWg4FmS7SmoqanSlEmG4gmSzHFxfSb7kFx7Qcb7OiNSRCMwkcvcVCv7FSCmPI3cMczkvbeSYI1ETbN9gcZtwGcIwhmcqcNoLElxWFmIwHwmGCnuLElcFGNwQEemPI1wgczk5FmSzHFxGbMgLhm7TgekQbmofSbx7HndTGZ4FhetsBnogEMgvFmS7SMwbSsxEAWo4FmIwHwoGBMwLEM4OgeiQiN7oBbg7hFa4GlSFiwKVEFkLaziobeSYgmKvBNtLaWGwFs7QiFa3cnmLhCgvFse4iZaQUFgBEWoZgxkyJmeVUfaHFx71GN4BI1a0he4HcvCtCmItHcofCNqHcw74Fmi2H1cGAnmLEwoTFMiFJCmPIsulhmgQbeSYgmKvBNtLaWGwFs7QiFa3cnmLhCgvFse4iZaQUFgBEnkZFFw1Iwc3ancHczk1GNw1HF73cNqlhcgvFckQiZSqUb7kcw7QGZm7SmoqanSlEmG4BNw1HmMVcnolEbMTGl7Wh17PEsWnYBdR73arHZcR0y2MaWtDAMxECwQnbW9DEsdTEe8T7wWO7WoqEFtMaZkZFMAtiZ0vbldnYBM6yMm7BCm7BCm7Bbx7hyKMaWtDAMxECwQnbW9DEsdTEe8T7wWO7Zx0ClulBeWZb3M4hNSqanikAvcqFciUhxmqUfgkJbcPGl0TimOvBNklaZk2GMA4HZ0VbNgkcwe4bmaSEWwCCbuUc1EVbNo7SCwCCfmUAwOVFckYIxmfBnSHFeW4gfmYhcofcNqFB1tzFmS7SMmpCMocEe4FcbxUBmATS1mEAWoRGZW4EFSxhec7HN9o7VMKXLa7BCm7BCm7Bbx7h1TKXLa3be9yACtbFViDbW8TEsdTbvdnfBKnBFmzHFxfEFkHEmgUFmiBIxmFClclawcobZmYI17faN4HCvMWbxi1EFa3U1mEAWoTGN4yEFasBbgmJCoPGMiQh17RCNgLFxGTFckBI10VSFgkcwxobZm7JemoiZmgcW2TGlSYgNxfCFmDHCM97VMKXLawIZcVfZmM0y2MaWtDAMxECwQnbW9DEsdTEe8T7wWO7WmoiZmgcW2TGcI4icKvbngMFeoPFmS7SMmpgxSCEcgaFsdtAmaxiZmEAWoOgekBJFxfBlxMaZtZGNT4Ixo1Ub7SHCMZBFqUiN7fcluBEWoZgxkyAmmqUbxMaMoZGlSaiFSqcNkgEwxvFb04ixoGCfcHEWoZgxkuicmfBngMFxxvg1wQHxKVbngLaw7NGvSBH1SRCfSScxMWbCagiW45cfkUa1QWbFmzJM9eHvuUJMcvbFoSEMwCgzoScxm4bFmzHCtsBN4lhbMtGWG4IxosBbg7gvW97VMKXLa7BCm7BCm7Bbx7h1TKXLa3be9yACtbFViDbW8TEsdTbvdnfBKnBFmzHcOvBngMFe7NGv7OH1SqcNgMBeoOFb7WI17qg1glaWg4FcItJMmPIsi7hCgzGWG4IxosBbg7HMm4bFouJM9CabSDa1i4bCauSe9CBFmEAWoQgCkygNxfCFmDHCowgxi2IWmoiZmkFe4NFN4YiN7FUfokaWg4FmS7SmoqanSlEmG4gmSzHFxfSb7kFx7Qcb7OiNSRCMwkcvcVCv7FSCmPI3cMczkvbeSYI1ETbN9gcZtwGcIwhmcqcNoLElxWFmIwHwmGCnuLElcFGNwQEemPI1wgczk5FmSzHFxGbMgLhm7TgekQbmofSbx7HndTGZ4FhetsBnogEMgvFmS7SMwbSsxEAWo4FmIwHwoGBMwLEM4OgeiQiN7oBbg7hFa4GlSFiwKVEFkLaziobeSYgmKvBNtLaWGwFs7QiFa3cnmLhCgvFse4iZaQUFgBEWoZgxkyJmeVUfaHFx71GN4BI1a0he4HcvCtCmItHcofCNqHcw74Fmi2H1cGAnmLEwoTFMiFJCmPIsulhmgQbeSYgmKvBNtLaWGwFs7QiFa3cnmLhCgvFse4iZaQUFgBEnkZFFw1Iwc3ancHczk1GNw1HF73cNqlhcgvFckQiZSqUb7kcw7QGZm7SmoqanSlEmG4BNw1HmMVcnolEbMTGl7Wh17PEsWnYBdR73arHZcR0y2MaWtDAMxECwQnbW9DEsdTEe8T7wWO7WoqEFtMaZkZFMAtiZ0vbldnYBM6yMm7BCm7BCm7Bbx7hyKMaWtDAMxECwQnbW9DEsdTEe8T7wWO7Zx0ClulBeWZb3M4hNSqanikAvcqFciUhxmqUfgkJbcPGl0TimOvBNklaZk2GMA4HZ0VbNgkcwe4bNouiW45AfkSceevbNouEC4PBfoUAwOVFckYIxmfBnSHFeW4gfmYhcofcNqFB1tzFmS7SMmpCMocEe4FcbxUBmATS1mEAWoRGZW4EFSxhec7HN9o7VMKXLa7BCm7BCm7Bbx7h1TKXLa3be9yACtbFViDbW8TEsdTbvdnfBKnBFmzHFxfEFkHEmgUFmiBIxmFClclawcobZmYI17faN4HCvMWbxi1EFa3U1mEAWoTGN4yEFasBbgmJCoOFbSBI10VSFglElMtGZwUhemPhZmBECoAcmgygmacaMwCAWmvBFw1E1a0BnughmGTGcI4icKVh1qGEwm4BForHceVUfaHFx70GZW4EFSxCnulEM2tGvSUI10VScSLElMTb14YhxmfbluEaW4ZGmiFEetqg3mLEwgzbekHIxmFUFoLEnkpFsSUExmGBluEaeCVbWauEMweGvcSaec2bnocIW45BbSSJMCVbea7JM4PabaSJMCVbFo7IWmoiZmHEWoZgxkygNxfCFmDHCM97VMKXLa7BCm7BCm7Bbx7h1TKXLa3be9yACtbFViDbW8TEsdTbvdnfBKnBFmzHcOvBngMFe7NGv7OH1SqcNgMBeoOFb7WI17qg1glaWg4FcItJMmPIsi7hCgzGWG4IxosBbg7HMm4bFouJM9CabSDa1i4bCauSe9CBFmEAWoQgCkygNxfCFmDHCowgxi2IWmoiZmkFe4NFN4YiN7FUfokaWg4FmS7SmoqanSlEmG4beSYHxMvCnglhsmTFMS7SMmnDbWnYBdR73cvgf7jHFAKXLa3be9yACtbFViDbW8TEsdTbvdnfBKnBFmzHcMVJ3uHcvCTFs0tEFa3alukcvmwFs7QHWmPhZmSCWO4beSYI17RFnuMawgCGCI4JFaxJ3uLhfaEFmkpHC9qSbxLazivBFwQJmeVH1kkcvcTGNwMCwofbngLcvxQGNwBH1a3h3gLhxgwGckaHC9qFNkLBe4QbeSYI1ETcncMaZTTgcCth17RcFmDhm74gxicIWmRbNogczkQBForJetPcfS7hM4ZgxkYHmobBbg7HZabcsxFCcKTEC7CafiobeSYJcofSFqHFeoSGl7UH1a3h3gLHCMZBFwMJF0vcniGElxOGMizHCtsBNgGEWoQGMi1ScKVh3cMawg4GNw1IwKtUfiMhsmNClSYiNaGAnoaElmWFmkBaN7RCnuMB1tUFmIwEc7fEFmHcw7pFmiBJcofJ1kmFe74GlSHIxo3cnm7HndTGZ4FhetsBNgGEWoQGMi1ScKVh3cMawg4GNw1IwKtUfiMhsmNCl72immqanScaWgwFmi2aN7qaNmLawgpGZwFIwmGh3ilhbMVGciBh1SoBbgHhCgvGv7cIWmQUFglhcgvFckQgNxfSbuHFeowFci2gmKvAl7GEbm0GZW4EFS0bMaLElxQgecFiFa3hsumcbxQGN4Fa1x3ancLhcgvGvSYh173alclBeoZg1wQHwoGBFmDhcoOGMkUhetsBNgGEWoQGMi1ScKVh3cMawg4GNw1IwKtUfiMhsmNClSYiNaGAnoaElmWFmkBaN7RCnuMB1tUFmIwEcgGbNtaENkOgegBhZafEFmLhCgTGMkUJcofJ1kmFe74GlSHIxo3cnm7HnuqFci2JmobiZmGEbm4Fmi2H1cFUfuLhm7QGZWwH171UFglBxoNFsuMJF0vcnilEe4ZGmiFExS3anoCawgqgegYH1xfJe9gFxoYGmkyJF0vFNtLcwgwgekYh173alclBeoZg1wQHwoGBFmDhcoOGMkUhetsBNgGEWoQGMi1ScKVh3cMawg4GNw1IwKtUfiMhsmNClSYiNaGAnoaElmWFmkBB1SqUbxlaC4rFckBbcmGIscCavmOFMc2H1EvCM4HFe45FciMhxCVSfulBe7QgekYh173alclBeoZg1wQHwoGBFmDhcoOGMkUhetsBNgGEWoQGMi1ScKVh3cMawg4GNw1IwKtUfiMhsmNClSYiNaGAnoaElmWFmkBacofJ1kmcC4rFmiUImxqJ3ggEnaQFMgFJmoGBnolhcgvFckQiZSqUb7kcw7QGZm7SmoqanSlEmG4BNw1HmMVcnolEbMTGl7Wh17PEsWnYBdR73arHZcR0y2MaWtDAMxECwQnbW9DEsdTEe8T7wWO7WoqEFtMaZkZFMAtiZ0vbldnYBM6yNclH18KHnSrhm9mhNSrg1COFTOMaWtDAMxECwQnbW9DEsdTEe8T7wWO7ZEvcNogEmg5GzI9DBIo0sW+i37wgBTYfBtYCW9UfwuBacaCFc9ACMmUcyM6yNc2HfA6ynwmh3Sm01mN0yKMi3mTgBd9DBdZYBu6yLa7BCm7BCm7Bbx7BFTKDBu7BCm7BCm7Bbx7BCMO737mGFSWHF9RYbQY7em7BCm7BCm7BCmQBBd90ya3be9yACtbFViDbW8TEsdTbvdnfBKnGCkBE1S0bbgEJbmRGZw1iZxsSFwgcW4QFFW4iNx4SFoLEluZFlSYH1S3H3kLasmpGl7UgNxfCbmUHmMtbWagEW4ebb7UaeCVbmauEC44Fl7gFeoTFciYIwoGbbmmJCoTGN4yEFasBbgmJCoOgekBJFxfBlxMaZtZGNT4Ixo1Ub7SHCMZBFqUiN7fclucENtwFl72hxc3UfoMaMoZGlSaiFSqcNkgEwxvFb04ixoGCfclavm5geEwJNxfSF4Lawcvg1wQHxKVbngLaw7NGvSBH1SRCfSScxMWbCaSJe9eCbuDc1EwbnmzEW9ebfiUc1ivbeS7IWmqFNtHcw7oFciUImKVh1q7HN9o7VMKXLaThzSWfZmM0y2MaWtDAMxECwQnbW9DEsdTEe8T7wWO7WmoiZmHhcgQFMiYHxMVi1glhcgOFbSBI10VSFgkcwxobZm7DBIo0y2MBCm7BCm7BCMtBCmQ0y2MaWtDAMxECwQnbW9DEsdTEe8T7wWO7WmoiZmHhcgQFMiYHxMVi1glElMtGZwUhemPhZmCEeoXCmcUcCmoiZmkFe4NgekYHxMVi3uLhFaNFmIwHNSRh3iMawgpBFoThcmfJ3oHCzioFciUE10vBNgkcwxobZm7DBIo0y2MifSmIm9ogydR7eiEbW7ubxSh7W9DbvdTEsuDEyiiYyi7HfioFb72IxofSbuGEletgei1E1xfUfcGENtpBForHCwoBlmEAWOtGv7FacofFNkMczKTCciUE10vBFmDhcoOGMkUhetsBnogEMgvFmS7SMwbSsxNCwoOFb7Uh1EvbNgMavmVFmIWUBIo0y2Mi19pgF2KXLa3be9yACtbFViDbW8TEsdTbvdnfBKnBNWth1a3H3gHasxzGlSUEyIoUTOMBCm7BCm7BCm7EFTt0yd901ovhZ4jg1clhZamYem7BCm7BCm7Bbx7hyKMBCm7BCm7BCm7BFt7YBtWIncmYbQYHFGKYyxoIzSmiyKMBCm7BCm7BCm7EFTtFVa3be9yACtbFViDbW8TEsdTbvdnfBKnFmkYJF0vBnOnYcWo0yGN0FmvIZcWYya7BCm7BCm7BCMthsxh7eiEbW7ubxSh7W9DbvdTEsuDEyiiYyiHFeo4GlS7DBIofBMo03QYgFSOhVuPIZ9RfZcRGZ9MgBkhyLa3be9yACtbFViDbW8TEsdTbvdnfBKnGvSFHmMVcnolivW97VMKDb4WIncmXdoiXeobbW4jCx7xcxagfwuBBC4CYbQYgfkoisQYjFcQIZCKJTOMhfSn0sWKYya7BCm7BCm7BCMthsxh7eiEbW7ubxSh7W9DbvdTEsuDEyiiYyiHFeo4GlSYJLIofcQTfcQMaWtDAMxECwQnbW9DEsdTEe8T7wWO7Z7fcnolEMgRFme9DBIofBdR7eiEbW7ubxSh7W9DbvdTEsuDEyiiYyiECbW97VMKXLa7BCm7BCm7BCMthsxh7eiEbW7ubxSh7W9DbvdTEsuDEyiiYyiHFeo4GlSYJLIofcQTfcQMaWtDAMxECwQnbW9DEsdTEe8T7wWO7ZEvcnaLcWg4gce9DBIofBMKDv8O7em7BCm7BCm7BbxQEcQMaWtDAMxECwQnbW9DEsdTEe8T7wWO7woGBnmLEWM97VmiFVa3be9yACtbFViDbW8TEsdTbvdnfBKnGmiFJNEVaN4HCbW97Vmi0y2MaWtDAMxECwQnbW9DEsdTEe8T7wWO7WtaDbWnYBdR7em7BCm7BCm7BbxQEcQMaWtDAMxECwQnbW9DEsdTEe8T7wWO7woGBnmLEWM97VmiFVa3be9yACtbFViDbW8TEsdTbvdnfBKnGvSFi17fanmmCbW97VmiYbQYgFSOhVuPIZ9RfZcRGZ9MgBkhyLa3be9yACtbFViDbW8TEsdTbvdnfBKnGvSFHmMVcnolivW97VMKDb4NGFtvgBTY7eiEbW7ubxSh7W9DbvdTEsuDEyiiYyiLFe4R7VMKDb2MhfSnymWQBmSDbm9ACMcCcxmjCx77bmAoUTomJ1mWUTo9ynwmh3Sm01mN0yKMi3mTgBd9DBdzYBu6yLaTGFimfZmM0sWK7x9BacxcacSCFVa3be9yACtbFViDbW8TEsdTbvdnfBKnGWI4JNa1UfuHAbW97VmiUTOMBCm7BCm7BCm7BFt70sWK7eiEbW7ubxSh7W9DbvdTEsuDEyiiYyikBx0TGWkSSMt4UF4lhCgzGCEwhcmfbNtghbmZGfMwHN0VE3gHEWoOGWiOJ17eUFqLEM4NGciaUC4PBbSUHMwzbwaaEM9CabuUJNQWbNmHEmmGBnugcWovFmkSUFc4BnuLhM0tgeS7SNc4BNoLElxzGlSUh1SQUFtLhm74gcG4iZ0Vh3cMAWMZBFwQiF73h3cHclmPGl0tiZ0vbNtlHCmvBFwUiN7GAnglEmg4FsSUiNaGBNoHclm5gxkYhcmfbNt7HN9oGWi1hmoFUfmHcW4ZGmIth17qCNkMaZtZGNT4ExmfBFmEAWoTFMiFi1S3UbuHcvcPFmG4E10Vi1tLHCMZBFoaiwoqBNtSa1aobxacJcoPFfaUaxm4FmEtHC4ecbSEceWtFcacJe43FfogJMCTFFT4aw7ccMc7HfioGv04EFSqbNt7HN9oclxMFemoiZmgFxgpGciFicMVcFmDhnSoGWkYI1aqaNomCWMZgfmYH173J3gMJCMZcveTIWmqBNklEmgNGvSBH1a3cFmDHCo1cNqFCwicUC9BCWmvBFwBh17RHZmDh3aMbeSYExmfg1gHF1kzFcIwJNxfUfcGEW2TFckBhemPhZmFcbcCcCcFaxScFMoBccxogmKTIWmqEFtlEW4OFl7cHC9RIZmlhCgwFl7FJMmPI17GCziogeiFS1asBbg7gvW97VMR71wmIzSkgZCR7eiEbW7ubxSh7W9DbvdTEsuDEyiiYyi7hluvBF4MI1a3H1gMaWgRGve4Ixo0bFmDh3aMbeSYExoGHsuGEmoZGZWtH1a1Ufilhcg5FmkBgNxfCFmDHCmzBFmzHFS3aN4Hclm4FmiUiN7fEFtLhc7OgeiQiN7oBbgmJCozFciMhxKVh1q7HN9o7VMR73ukgZcjHFAR7eiEbW7ubxSh7W9DbvdTEsuDEyiiYyi7HfioGZwFHmKvClclawcobZmYCcAtbMoFaFtfCmSYUCtsBnSLENaRGcIwhMmPIsi7hC4ZGmkyiNEVcnmGEW4QGvSUI10VSFgkcwxobZm7Eew3FNmHceevFFMTECwqFb7EcxeVbFwcixmPCbxUJbu5bmixECwCCNwSEMw2bMi7HFgbiZmLhCGVGciMH1a3h3gLhsmpFckBHemPIsi7hCGTgekYIxmRclukcvmwFs7QHwKvFfm7HN9ocCkYimoqh3SHcC4ZGmiFExcqcl7kcwGvGvxBHxmQBngLEwxwGZwFHxMvCfSgElmWFmkaiFS0BngHhFtvFmEwJcoGFnuHF1a5bekFicoGH3iHcW2TFmiaIWwCFbcSaxc4bCa7Je45bbxUJfITbMa7EMweafSSHmczbcauiW9eFbxUJMeWbmaaECteixaHcWg4Fb7Oa10VEFtMaFavGl7YH171bNtgFeoPGCcBhxoqalxLBx7cFciYCZ0VUbuEhMoQFciUEet3bngLcwGTb14UhxmGBNokalm4FmkUEF70CnoEhc7QFNw1EF70CNgMaWgobekFicoGH3iHcW2TFmiaIWwCFbcSaxc4bCa7iW4PBbSDAzIvbNoaEWwCGzSSJNq2bno7Ee4eabuUHMMTbNolEMteixaHcWg4Fb7Oa10VEFtMaFavGl7YH171bNtgFeoPGCcBhxoqalxLBx7cFciYCZ0VUbuEhMoQFciUEet3bngLcwGTb14UhxmGBNokalm4FmkUEF70CnoEhc7QFNw1EF70CNgMaWgobekBH1S1UfoHcWg4Fb7OgmmqanmEaeCVbwauECwPAfmSaxeWbmacIWwCcbxDaem2beaSSCwCGzmUaxx2bMagJC4eFbSUHfiogmSzHFa0BNkgEnaTGNwlHC9Qi3cMczkvFxSzHcoGFNtLhm7NGv7OH1SqcNgLcwGTFciBH1a3aFmDhnSoGvSFJcoqaNoHCWMZBFWwh1AvbNwHcwgpBF2TIWmqaNoMavm4Fs7QHWmPhZMnYB2MifSmIm9ogy2MaWtDAMxECwQnbW9DEsdTEe8T7wWO7WmoiZmgEnkTFmIwExKVEbxMaWGTGcI4icKVh1q7HN9obNmYUCtsBNqkFe4zGMi1SceVUfaLcwgwgekUawofcNqghCgPGbuUiN7RCNtmBxxobZWwEF73izS7hc7TGvSyIwmGheaLElxWFmIwE1ETbngLhm7QgCkBaN7qaNmLawgeGl0tixofSbu7Hnuwgxi2IWtsBNqkFe4zGMi1SceVUfaLcwgwgekUa10VSbuHF1KTCwkUAmo1AnmHFxoTFmklHC9qSbxLazivBFwBI1EvAnSgF1teGl0tixofSbulEe4ZGN4Bh1c0CMolEegRFlSYhxOValuHcw7CGCi1JcobBbgLhmgvGMSzHco3h3olazkOgccUiN7fEFtLhm75Cb04iFa3claMaFt5cbSBiNSRhxaHFxxobZWwEF73izS7hcoQFmiBbF0VbNkMaZtZGNm7SMmQAM7BExgNcbxFCw7paMaBclmbCmcUCxacECgCHw7ycMcQCxaQbFmEAWoqFmiFHwmqaNokEC4ZgxkYHmobBbgSAzioFNW4HNaGbMaLElxWFmIwExScCFmDhbCtGMizIWmqg3mkcw7UFmiBIxmFg3uHBx7rBFoTiFafJ3SEAWoRGZW4EFSxhec7Hnuwgxi2IWtsBnogEMgvFmS7SMwbSsxEAWozGZwQEmmfblccEmgvFmiUE10vBmSHcvcpFmkYbF0VbNkMaZtZGNm7SMmpbmuCccgcFsxUcccpcM7CCWmvBF4Yh17qCNtlHzkZFb71E1xfUfc7HN9ogeiQixofJ3uLhccobeSYEFEVcMcHcwoOgxi2ExxfbluLEWmobZwHH170bNtEAWoTGN4HI1a3cmakavm4gec2I17qietHF1qobZWwEF73izS7hFt5CNwFhxosBbgHhCgvGv7cIWmqh3oBhmgwFMkYH1xGbNtlHCMZFNw1IZEVcfS7hFt5CN4Fic7qaNoMaM7ZGvSaHC9qFNkLBe4QbeSYI1ETg3mLEwgzBFoThcmfJ3oHCzioGckUaNaqcncMAWMZFNw1IZEVcfS7hFt5cMiQixofJ3uLhccobZ4BJFafcfS7hFt5cb04HNxfanSCawgOGZWwI17qGZmDhcoOGMkUhetsBnulEC7OFl7FbwoGg3oBhcgQFMS7SmoqanSlEmcvBFwQJmc0BngHhFtvFmgYh1aqh1tMEWwobZ4BJFafcfS7hFt5cl04JFetbN9gFeoQFMcBJcmfFlu7HnuqFci2JmobiZmFccoYbFqUiN7fEFtLhm75cCkYiNaqh1qHFeoNFb04i17fcncMBe4EFmkpHC9oBmxlhbmqGci2hxeVUfaHFx7bFmkHIxoGg3oFaWgocFW4EFa3cFmEAWorFckUhZa3aN47Hnuwgxi2IWtsBNogcvcFGv7FJcafancgcZaQcs7HhcoGBno7HnuqFci2JmobiZmGEbm4Fmi2H1cFUfuLhm7QGZWwH171UFglBxoNFsuQJmGVUfmkEcg5FmkYJcofJ1kmFe74GlSHIxo3cnm7HnuqFci2JmobiZmGEbm4Fmi2H1cFUfuLhm7QGZWwH171UFglBxoNFsuQJmafcnmHECgycCI4IZ70bnmHczkOgckyJF0vFnuHawg4BFoThcmfJ3oHCzioFse4JcofJ1kmclmTGN4Bh1SqSFkLalmNGWkHgmKtbluLEWoTFmkUANSqEFkHaZtvGMI4CwoGAnSmccgwFciYIwofCnmHczkOgckyJF0vFnuHawg4BFoThcmfJ3oHCzioFse4JcofJ1kmclmTGN4Bh1SqSFkLalmNGWkHgmKtbluLEWoTFmkUCZxfSF4lhcgvFckQiZSqUb7kcw7QGZm7SmoqanSlEmG4BNw1HmMVcnolEbMTGl7Wh17PEsWnYBdR73arHZcR0y2MaWtDAMxECwQnbW9DEsdTEe8T7wWO7WoqEFtMaZkZFMAtiZ0vbldnYbQY7em7BCm7BCm7BbxQEBdKDBuPIZ9RfZamGZ9MgBk7BCm7BCm7BCMtBFTO7em7BCm7BCm7BCmQBBMQi37wgBM6yNmN0yKkHfSvgfAO7em7BCm7BCm7BbxQEcQMaWtDAMxECwQnbW9DEsdTEe8T7wWO7woGBnmLEWo57VmiYBdN7LxoIzSmiyKMBCm7BCm7BCm7EFTtFVa3be9yACtbFViDbW8TEsdTbvdnfBKnFmkYJF0vBbWnYcWoYBu6yNclH18KHnSrhm9mhNSrg1COFTOMaWtDAMxECwQnbW9DEsdTEe8T7wWO7ZEvcNogEmg5GzI9DBIo0sW+i37wgBTYfBtYCW9UfwuBacaCFc9ACMmUcyM6yNc2HfA6ynwmh3Sm03QY71wvgVd90yKMBCm7BCm7BCm7EFTtFVa3be9yACtbFViDbW8TEsdTbvdnfBKnFmkYJF0vBnOnYcwhExwh7eiEbW7ubxSh7W9DbvdTEsuDEyiiYyiLcwg5Gv71hmoaDbWnYcWKXLa3be9yACtbFViDbW8TEsdTbvdnfBKnbxe9DBIo0y2MBCm7BCm7BCm7EFTtFVa3be9yACtbFViDbW8TEsdTbvdnfBKnFmkYJF0vBnOnYcwhExwh7eiEbW7ubxSh7W9DbvdTEsuDEyiiYyilEwgWGmi1JFcaDbWnYcWo0s8/Yya7BCm7BCm7BCMthsxh7eiEbW7ubxSh7W9DbvdTEsuDEyiiYyiHFeo4GlS7DBIofcQMaWtDAMxECwQnbW9DEsdTEe8T7wWO7Z7fcnolEMgRFme9DBIofBdR7eiEbW7ubxSh7W9DbvdTEsuDEyiiYyiECbW97VMKXLa7BCm7BCm7BCMthsxh7eiEbW7ubxSh7W9DbvdTEsuDEyiiYyiHFeo4GlS7DBIofcQMaWtDAMxECwQnbW9DEsdTEe8T7wWO7ZEvcnaLcWg4gce9DBIofBM6yNclH18KHnSrhm9mhNSrg1COFTOMaWtDAMxECwQnbW9DEsdTEe8T7wWO7ZEvcNogEmg5GzI9DBIo0sW+gNxQIZCQyLa3be9yACtbFViDbW8TEsdTbvdnfBKnGmkUhLIo0sW+71wvgToiXeobbW4jCx7xcxagfwuBBC4CYbQYgfkoisQYjAo9ylQ=KOKq\sUlc}aLpH

Function Calls

time 2
fopen 1
fread 3
strtr 2
fclose 1
urldecode 1
str_replace 1
base64_decode 4

Variables

$O000O0O00 True
$O0O000O00 fgets
$O0O000O0O fgetc
$O0O00OO00 fread
$OO00O0000 26484
$OO00O00O0 include $GLOBALS['OOO0000O0']('Li4vY29yZS5waHA='); $GLOBALS..
$OOO000000 fg6sbehpra4co_tnd
$OOO00000O strtr
$OOO0000O0 base64_decode
$OOO000O00 fopen
$OOO0O0O00 index.php
$IIIIIIII1II1 base64_encode
$IIIIIIIII111 array_rand
$IIIIIIIII1lI header
$IIIIIIIIIl1I trim
$IIIIIIIIl1l1 explode
$IIIIIIIIlI11 urlencode

Stats

MD5 2a7fcc47cf36c51967e7104ea5d6257f
Eval Count 4
Decode Time 158 ms